| Name |
Isocorydine (+)-Isocorydine (S)-(+)-Isocorydine L-(+)-Isocorydine |
| Formula |
C20H23NO4 |
| Mw |
341.16270823 |
| CAS RN |
475-67-2 |
| C_ID |
C00001872
, 
|
| InChIKey |
QELDJEKNFOQJOY-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C20H23NO4/c1-21-8-7-12-10-15(24-3)20(25-4)18-16(12)13(21)9-11-5-6-14(23-2)19(22)17(11)18/h5-6,10,13,22H,7-9H2,1-4H3/t13-/m0/s1 |
| SMILES |
COc1ccc2c(c1O)-c1c(OC)c(OC)cc3c1[C@H](C2)N(C)CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona cherimola  | Ref. |
| Plantae | Annonaceae | Annona glabra  | Ref. |
| Plantae | Annonaceae | Annona purpurea  | Ref. |
| Plantae | Annonaceae | Annona senegalensis  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Annonaceae | Artabotrys suaveolens | Ref. |
| Plantae | Annonaceae | Artabotrys uncinatus  | Ref. |
| Plantae | Annonaceae | Guatteria oliviformis | Ref. |
| Plantae | Annonaceae | Miliusa velutina  | Ref. |
| Plantae | Berberidaceae | Berberis densiflora | Ref. |
| Plantae | Berberidaceae | Berberis heterobotrys | Ref. |
| Plantae | Berberidaceae | Berberis oblonga | Ref. |
| Plantae | Berberidaceae | Berberis vulgaris  | Ref. |
| Plantae | Berberidaceae | Mahonia aquifolium | Ref. |
| Plantae | Berberidaceae | Nandina domestica  | Ref. |
| Plantae | Euphorbiaceae | Croton chilensis | Ref. |
| Plantae | Euphorbiaceae | Croton hemiargyreus | Ref. |
| Plantae | Fumariaceae | Corydalis cava  | Ref. |
| Plantae | Fumariaceae | Corydalis lutea | Ref. |
| Plantae | Fumariaceae | Corydalis ochroleuca | Ref. |
| Plantae | Fumariaceae | Corydalis solida  | Ref. |
| Plantae | Fumariaceae | Corydalis tuberosa | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Fumariaceae | Dicentra canadensis  | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
| Plantae | Fumariaceae | Hypecoum procumbens | Ref. |
| Plantae | Fumariaceae | Sarcocapnos enneaphylla | Ref. |
| Plantae | Fumariaceae | Sarcocapnos saetabensis | Ref. |
| Plantae | Lauraceae | Dehaasia incrassata | Ref. |
| Plantae | Lauraceae | Dehaasia triandra | Ref. |
| Plantae | Lauraceae | Lindera pipericarpa | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Lauraceae | Litsea deccanensis | Ref. |
| Plantae | Lauraceae | Ocotea benesii | Ref. |
| Plantae | Lauraceae | Ocotea holdrigeana | Ref. |
| Plantae | Lauraceae | Ocotea holdrigeiana | Ref. |
| Plantae | Lauraceae | Ocotea vellosiana | Ref. |
| Plantae | Lauraceae | Phoebe clemensii | Ref. |
| Plantae | Menispermaceae | Stephania brachyandra | Ref. |
| Plantae | Menispermaceae | Stephania cepharantha  | Ref. |
| Plantae | Menispermaceae | Stephania dinklagei | Ref. |
| Plantae | Menispermaceae | Stephania dinklaget | Ref. |
| Plantae | Menispermaceae | Stephania lincangensis | Ref. |
| Plantae | Menispermaceae | Stephania macrantha | Ref. |
| Plantae | Menispermaceae | Stephania officinarum | Ref. |
| Plantae | Menispermaceae | Stephania pierii | Ref. |
| Plantae | Monimiaceae | Siparuna griseo-flavescens | Ref. |
| Plantae | Papaveraceae | Glaucium corniculatum  | Ref. |
| Plantae | Papaveraceae | Glaucium fimbrilligerum | Ref. |
| Plantae | Papaveraceae | Glaucium flavum  | Ref. |
| Plantae | Papaveraceae | Glaucium spp. | Ref. |
| Plantae | Papaveraceae | Papaver commutatum | Ref. |
| Plantae | Papaveraceae | Papaver confine | Ref. |
| Plantae | Papaveraceae | Papaver pinnatifidum | Ref. |
| Plantae | Papaveraceae | Papaver rhoeas  | Ref. |
| Plantae | Papaveraceae | Papaver rhopalothece | Ref. |
| Plantae | Papaveraceae | Papaver spp. | Ref. |
| Plantae | Papaveraceae | Papaver stevenianum | Ref. |
| Plantae | Ranunculaceae | Isopyrum thalictroides | Ref. |
| Plantae | Ranunculaceae | Thalictrum delavayi | Ref. |
| Plantae | Ranunculaceae | Thalictrum pedunculatum | Ref. |
| Plantae | Ranunculaceae | Thalictrum urbainii | Ref. |
| Plantae | Rutaceae | Xanthoxylum brachyacanthum | Ref. |
| - | - | Dactylocapnos torulosa | Ref. |
|
|
zoom in
| Organism | Fumaria vaillantii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|