| Name |
(+)-Aromadendrene Aromadendrene (+)-Aromadendr-7(15)-ene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
489-39-4 |
| C_ID |
C00021230
, 
|
| InChIKey |
ITYNGVSTWVVPIC-CREYNYQSNA-N |
| InChICode |
InChI=1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h10-14H,1,5-8H2,2-4H3/t10-,11+,12-,13+,14-/m1/s1 |
| SMILES |
C=C1CC[C@@H]2[C@H]([C@@H]3[C@H](C)CC[C@@H]13)C2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Guatteriopsis blepharophylla | Ref. |
| Plantae | Annonaceae | Xylopia frutescens  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia trilobata  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Trichogonia grazielae | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Rhynchosia minima  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Jubulaceae | Frullania lobulata | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Pogostemon cablin  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
| Plantae | Lepidoziaceae | Lepidozia fauriana | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Myrtaceae | Eucalyptus blakelyi | Ref. |
| Plantae | Myrtaceae | Eucalyptus microtheca  | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
| Plantae | Piperaceae | Piper obliquum  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Valerianaceae | Nardostachys grandiflora  | Ref. |
| Plantae | Verbenaceae | Lippia javanica  | Ref. |
| Plantae | Zingiberaceae | Curcuma kwangsiensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
| Plantae | Zingiberaceae | Curcuma wenyujin  | Ref. |
| Plantae | Zingiberaceae | Renealmia chrysotrycha  | Ref. |
|
|
zoom in
| Organism | Thymus maroccanus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|