| Name |
Antirrhinin Cyanidin 3-rutinoside |
| Formula |
C27H31O15.Cl |
| Mw |
630.13514803 |
| CAS RN |
18719-76-1 |
| C_ID |
C00002376
, 
|
| InChIKey |
USNPULRDBDVJAO-ZZPKNHKLNA-O |
| InChICode |
InChI=1S/C27H30O15/c1-9-19(32)21(34)23(36)26(39-9)38-8-18-20(33)22(35)24(37)27(42-18)41-17-7-12-14(30)5-11(28)6-16(12)40-25(17)10-2-3-13(29)15(31)4-10/h2-7,9,18-24,26-27,32-37H,8H2,1H3,(H3-,28,29,30,31)/p+1/t9-,18+,19-,20+,21-,22+,23+,24+,26+,27+/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3cc4c(O)cc(O)cc4[o+]c3-c3ccc(O)c(O)c3)C(O)C(O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera caerulea | Ref. |
| Plantae | Aceraceae | Dipteronia sinensis | Ref. |
| Plantae | Alstroemeriaceae | Alstroemeria sp. | Ref. |
| Plantae | Araceae | Anthurium andraeanum | Ref. |
| Plantae | Araceae | Arum maculatum  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Cosmos bipinnatus | Ref. |
| Plantae | Bignoniaceae | Arrabidaea spp. | Ref. |
| Plantae | Bignoniaceae | Incarvillea delavayi | Ref. |
| Plantae | Boraginaceae | Lobostemon spp. | Ref. |
| Plantae | Calochortaceae | Tricyrtis formosana | Ref. |
| Plantae | Cannaceae | Canna x generalis | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus suecica  | Ref. |
| Plantae | Euphorbiaceae | Manihot utilissima  | Ref. |
| Plantae | Euphorbiaceae | Poinsettia spp. | Ref. |
| Plantae | Lauraceae | Cinnamomum spp. | Ref. |
| Plantae | Liliaceae | Tulipa gesneriana  | Ref. |
| Plantae | Linaceae | Linum grandiflorum | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia spp. | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Musaceae | Musa acuminata  | Ref. |
| Plantae | Musaceae | Musa x paradisiaca | Ref. |
| Plantae | Oleaceae | Olea europaea  | Ref. |
| Plantae | Orchidaceae | Dracula chimaera | Ref. |
| Plantae | Palmae | Euterpe edulis  | Ref. |
| Plantae | Palmae | Euterpe oleracea  | Ref. |
| Plantae | Palmae | Pinanga polymorpha | Ref. |
| Plantae | Plantaginaceae | Antirrhinum majus  | Ref. |
| Plantae | Poaceae | Alopecurus spp. | Ref. |
| Plantae | Poaceae | Anthoxanthum spp. | Ref. |
| Plantae | Poaceae | Avenula spp. | Ref. |
| Plantae | Poaceae | Bothriochloa spp. | Ref. |
| Plantae | Poaceae | Dactylis spp. | Ref. |
| Plantae | Poaceae | Deschampsia spp. | Ref. |
| Plantae | Poaceae | Elymus spp. | Ref. |
| Plantae | Poaceae | Festuca spp. | Ref. |
| Plantae | Poaceae | Hordeum spp. | Ref. |
| Plantae | Poaceae | Miscanthus spp. | Ref. |
| Plantae | Poaceae | Molinia spp. | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Oryza spp. | Ref. |
| Plantae | Poaceae | Pennisetum setaceum | Ref. |
| Plantae | Poaceae | Phalaris spp. | Ref. |
| Plantae | Poaceae | Phleum spp. | Ref. |
| Plantae | Poaceae | Poa spp. | Ref. |
| Plantae | Poaceae | Secale sp. | Ref. |
| Plantae | Poaceae | Sinarundinaria spp. | Ref. |
| Plantae | Poaceae | Triticum sp. | Ref. |
| Plantae | Polygonaceae | Rheum spp. | Ref. |
| Plantae | Polygonaceae | Rumex spp. | Ref. |
| Plantae | Rosaceae | Potentilla atrosanguinea | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rosaceae | Rosa spp. | Ref. |
| Plantae | Rosaceae | Rubus spp.  | Ref. |
| Plantae | Salicaceae | Populus tremula  | Ref. |
| Plantae | Sapindaceae | Acer buergerianum | Ref. |
| Plantae | Sapindaceae | Acer palmatum | Ref. |
| Plantae | Sapindaceae | Litchi chinensis  | Ref. |
| Plantae | Solanaceae | Petunia exserta | Ref. |
|
|
zoom in
| Organism | Olea europaea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Hayashi,Chem.Abstr.,49,(1955),10983
Kamsteeg,Z.Naturforsch.C.,33,(1978),475 |
|---|
|