| Name |
Guaiol (-)-Guaiol |
| Formula |
C15H26O |
| Mw |
222.19836545 |
| CAS RN |
489-86-1 |
| C_ID |
C00003139
, 
|
| InChIKey |
TWVJWDMOZJXUID-LDIWCFHQNA-N |
| InChICode |
InChI=1S/C15H26O/c1-10-5-7-12(15(3,4)16)9-14-11(2)6-8-13(10)14/h10-12,16H,5-9H2,1-4H3/t10-,11-,12+/m0/s1 |
| SMILES |
C[C@H]1CC[C@@H](C(C)(C)O)CC2=C1CC[C@@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Xylopia rubescens | Ref. |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Cannabaceae | Cannabis inflorescences | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cupressaceae | Callitris glaucophylla | Ref. |
| Plantae | Cupressaceae | Callitris neocaledonica | Ref. |
| Plantae | Cupressaceae | Neocallitropsis pancheri | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Labiatae | Mentha arvensis L.  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Magnoliaceae | Michelia champaca  | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
| Plantae | Pinaceae | Pinus halepensis  | Ref. |
| Plantae | Piperaceae | Piper lhotzkyanum | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Fortunella margarita  | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansi  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| Plantae | Zygophyllaceae | Guaiacum officinale  | Ref. |
| - | - | Alphinia galanga | Ref. |
|
|
zoom in
| Organism | Turnera diffusa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|