| Name |
(R)-(-)-alpha-Curcumene AR-Curcumene |
| Formula |
C15H22 |
| Mw |
202.1721507 |
| CAS RN |
4176-17-4 |
| C_ID |
C00011617
, 
|
| InChIKey |
VMYXUZSZMNBRCN-YQTOOIBONA-N |
| InChICode |
InChI=1S/C15H22/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8-11,14H,5,7H2,1-4H3/t14-/m1/s1 |
| SMILES |
CC(C)=CCC[C@@H](C)c1ccc(C)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Apiaceae | Ferula iliensis | Ref. |
| Plantae | Asteraceae | Ambrosia spp. | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Lychnophora ericoides Mart.  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Santolina rosmarinifolia subsp. canescens  | Ref. |
| Plantae | Asteraceae | Senecio vulgaris  | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Cistaceae | Cistus albidus | Ref. |
| Plantae | Fabaceae | Amorpha fruticosa | Ref. |
| Plantae | Fagaceae | Quercus coccifera  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Pinaceae | Pinus halepensis  | Ref. |
| Plantae | Santalaceae | Osyris tenuifolia | Ref. |
| Plantae | Zingiberaceae | Curcuma aromatica  | Ref. |
| Plantae | Zingiberaceae | Curcuma kwangsiensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
| Plantae | Zingiberaceae | Curcuma wenyujin  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|