| Name |
Cuminal Cumin aldehyde 4-Isopropyl benzaldehyde Cuminaldehyde Cuminyl aldehyde Cumaldehyde |
| Formula |
C10H12O |
| Mw |
148.08881501 |
| CAS RN |
122-03-2 |
| C_ID |
C00003039
, 
|
| InChIKey |
WTWBUQJHJGUZCY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H12O/c1-8(2)10-5-3-9(7-11)4-6-10/h3-8H,1-2H3 |
| SMILES |
CC(C)c1ccc(C=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Carum carvi  | Ref. |
| Plantae | Apiaceae | Cicuta virosa  | Ref. |
| Plantae | Apiaceae | Cuminum cyminum L.  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Conyza newii  | Ref. |
| Plantae | Asteraceae | Cyathocline purpurea | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Burseraceae | Commiphora abyssinica  | Ref. |
| Plantae | Burseraceae | Commiphora myrrha  | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
| Plantae | Fabaceae | Cassia fistula  | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Lavandula angustifolia  | Ref. |
| Plantae | Labiatae | Lavandula dentata  | Ref. |
| Plantae | Labiatae | Plectranthus marrubioides | Ref. |
| Plantae | Myrtaceae | Eucalyptus globulus  | Ref. |
| Plantae | Myrtaceae | Eucalyptus tereticornis  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
|
|
zoom in
| Organism | Eucalyptus tereticornis | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|