| Name |
Aphloiol Mangiferin 2-beta-D-Glucopyranosyl-1,3,6,7-tetrahydroxy xanthone |
| Formula |
C19H18O11 |
| Mw |
422.08491142 |
| CAS RN |
4773-96-0 |
| C_ID |
C00002962
, 
|
| InChIKey |
AEDDIBAIWPIIBD-JKQWEQCGNA-N |
| InChICode |
InChI=1S/C19H18O11/c20-4-11-15(25)17(27)18(28)19(30-11)12-8(23)3-10-13(16(12)26)14(24)5-1-6(21)7(22)2-9(5)29-10/h1-3,11,15,17-23,25-28H,4H2/t11-,15-,17+,18-,19+/m1/s1 |
| SMILES |
O=c1c2cc(O)c(O)cc2oc2cc(O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Anacardiaceae | Mangifera persiciformis | Ref. |
| Plantae | Anemarrhenaceae | Anemarrhena asphodeloides Bunge  | Ref. |
| Plantae | Aphloiaceae | Aphloia madagascariensis | Ref. |
| Plantae | Aspleniaceae | Asplenium montanum Willd. | Ref. |
| Plantae | Celastraceae | Salacia prinoides | Ref. |
| Plantae | Davalliaceae | Davallia solida  | Ref. |
| Plantae | Fabaceae | Hedysarum denticulatum | Ref. |
| Plantae | Fabaceae | Hedysarum sericeum | Ref. |
| Plantae | Gentianaceae | Gentiana algida | Ref. |
| Plantae | Gentianaceae | Gentiana campestris | Ref. |
| Plantae | Gentianaceae | Gentiana lutea  | Ref. |
| Plantae | Gentianaceae | Gentiana rhodantha | Ref. |
| Plantae | Gentianaceae | Gentiana triflora | Ref. |
| Plantae | Gentianaceae | Swertia angustifolia  | Ref. |
| Plantae | Gentianaceae | Swertia davidii | Ref. |
| Plantae | Gentianaceae | Swertia mussotii | Ref. |
| Plantae | Hypericaceae | Hypericum ancherii | Ref. |
| Plantae | Hypericaceae | Hypericum sampsonii | Ref. |
| Plantae | Hypericaceae | Hypericum spp. | Ref. |
| Plantae | Iridaceae | Belamcanda chinensis  | Ref. |
| Plantae | Iridaceae | Crocus aureus | Ref. |
| Plantae | Iridaceae | Crocus heuffelianus | Ref. |
| Plantae | Iridaceae | Crocus laevigatus | Ref. |
| Plantae | Iridaceae | Iris florentina | Ref. |
| Plantae | Malpighiaceae | Hiptage madablota | Ref. |
| Plantae | Malvaceae | Bombax malabaricum  | Ref. |
| Plantae | Malvaceae | Urena lobata  | Ref. |
| Plantae | Melianthaceae | Bersama engleriana Gurke | Ref. |
| Plantae | Polypodiaceae | Pyrrosia calvata | Ref. |
| Plantae | Polypodiaceae | Pyrrosia davidii  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia lingua  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia petiolosa  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia prinoides | Ref. |
| Plantae | Polypodiaceae | Pyrrosia pseudocalvata | Ref. |
| Plantae | Polypodiaceae | Pyrrosia sheareri | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Smilacaceae | Smilax bracteata | Ref. |
| Plantae | Thymelaeaceae | Aquilaria sinensis | Ref. |
| Plantae | Thymelaeaceae | Gnidia involucrata  | Ref. |
| Plantae | Thymelaeaceae | Phaleria macrocarpa  | Ref. |
| Plantae | Woodsiaceae/Dryopteridaceae | Athyrium mesosorum | Ref. |
|
|
zoom in
| Organism | Crocus aureus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|