| Name |
Quercetin 3-rutinoside Rutin Quercetin 3-O-rutinoside Birutan Quercetin 3-O-alpha-L-rhamnopyranosyl-(1->6)-beta-D-glucopyranoside Quercetin 3-O-beta-rutinoside (+)-Quercetin 3-O-beta-rutinoside (+)-Quercetin 3-O-rutinoside 3,3',4',5,7-Pentahydroxyflavone 3-rutinoside 3-Rutinosylquercetin Rutoside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
153-18-4 |
| C_ID |
C00005413
, 
|
| InChIKey |
IKGXIBQEEMLURG-UYYJLDMENA-N |
| InChICode |
InChI=1S/C27H30O16/c1-8-17(32)20(35)22(37)26(40-8)39-7-15-18(33)21(36)23(38)27(42-15)43-25-19(34)16-13(31)5-10(28)6-14(16)41-24(25)9-2-3-11(29)12(30)4-9/h2-6,8,15,17-18,20-23,26-33,35-38H,7H2,1H3/t8-,15+,17-,18+,20-,21-,22-,23+,26+,27-/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3c(-c4ccc(O)c(O)c4)oc4cc(O)cc(O)c4c3=O)C(O)C(O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Alliaceae | Allium ascalonicum  | Ref. |
| Plantae | Alliaceae | Allium obliquum  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Alliaceae | Allium Sativum | Ref. |
| Plantae | Amaranthaceae | Amaranthus spinosus  | Ref. |
| Plantae | Amaryllidaceae | Galanthus caucasicus  | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Annonaceae | Xylopia poilanei | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Bupleurum rotundifolium L.  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Glehnia littoralis  | Ref. |
| Plantae | Apiaceae | Tordylium apulum  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Nerium oleander  | Ref. |
| Plantae | Apocynaceae | Tabernaemontana heyneana  | Ref. |
| Plantae | Araliaceae | Cussonia bojeri SEEM | Ref. |
| Plantae | Araliaceae | Cussonia racemosa | Ref. |
| Plantae | Araliaceae | Cussonia vantsilana Baker | Ref. |
| Plantae | Aristolochiaceae | Aristolochia kaempferi | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asparagaceae | Asparagus racemosus  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Asteraceae | Achillea alexandri-regis Bornm.& Rudski | Ref. |
| Plantae | Asteraceae | Achillea millefolium  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia scoparia  | Ref. |
| Plantae | Asteraceae | Baccharis gaudichaudiana DC | Ref. |
| Plantae | Asteraceae | Bellis perennis  | Ref. |
| Plantae | Asteraceae | Calendula officinalis  | Ref. |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Asteraceae | Cirsium setosum | Ref. |
| Plantae | Asteraceae | Conyza filaginoides | Ref. |
| Plantae | Asteraceae | Dichrocephala bicolor  | Ref. |
| Plantae | Asteraceae | Eupatorium microphyllum | Ref. |
| Plantae | Asteraceae | Lactuca indica  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Pulicaria salviifolia | Ref. |
| Plantae | Asteraceae | Saussurea gnaphaloides | Ref. |
| Plantae | Asteraceae | Saussurea graminea | Ref. |
| Plantae | Asteraceae | Saussurea involucrata | Ref. |
| Plantae | Asteraceae | Saussurea nigrescens | Ref. |
| Plantae | Asteraceae | Saussurea parviflora | Ref. |
| Plantae | Asteraceae | Saussurea pulchella  | Ref. |
| Plantae | Asteraceae | Senecio nemorensis | Ref. |
| Plantae | Asteraceae | Senecio viravira | Ref. |
| Plantae | Asteraceae | Senecio yegua | Ref. |
| Plantae | Asteraceae | Silphium perfoliatum L. | Ref. |
| Plantae | Asteraceae | Solidago altissima | Ref. |
| Plantae | Asteraceae | Solidago virgaurea  | Ref. |
| Plantae | Asteraceae | Stevia rebaudiana  | Ref. |
| Plantae | Asteraceae | Tussilago farfara  | Ref. |
| Plantae | Betulaceae | Betula nigra  | Ref. |
| Plantae | Boraginaceae | Alkanna orientalis | Ref. |
| Plantae | Boraginaceae | Cordia macleodii | Ref. |
| Plantae | Cactaceae | Opuntia dillenii  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Campanula glomerata L. | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Capparaceae | Capparis spinosa L.  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Crassulaceae | Sedum ewersii | Ref. |
| Plantae | Crassulaceae | Sedum sarmentosum  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Gynostemma cardiospermum | Ref. |
| Plantae | Cucurbitaceae | Gynostemma pentaphyllum  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Ebenaceae | Diospyros rhombifolia | Ref. |
| Plantae | Elaeagnaceae | Hippophae neurocarpa | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides subsp.gyantsensis  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides subsp.sinensis  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides subsp.turkestanica  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides subsp.yunnanensis  | Ref. |
| Plantae | Elaeagnaceae | Hippophae thibetata | Ref. |
| Plantae | Ephedraceae | Ephedra campylopoda  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum cambodianum | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ovalifolium | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides Oliv.  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia hirta  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia larica | Ref. |
| Plantae | Euphorbiaceae | Euphorbia magalanta | Ref. |
| Plantae | Euphorbiaceae | Euphorbia tinctoria  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia virgata | Ref. |
| Plantae | Euphorbiaceae | Macaranga tanarius | Ref. |
| Plantae | Euphorbiaceae | Mallotus japonicus  | Ref. |
| Plantae | Fabaceae | Acacia nilotica  | Ref. |
| Plantae | Fabaceae | Caesalpinia pulcherrima  | Ref. |
| Plantae | Fabaceae | Cassia grandis  | Ref. |
| Plantae | Fabaceae | Cassia hirsuta  | Ref. |
| Plantae | Fabaceae | Clitoria ternatea  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra L.  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Onobrychis amoena | Ref. |
| Plantae | Fabaceae | Onobrychis bobrovi | Ref. |
| Plantae | Fabaceae | Onobrychis chlorassanica | Ref. |
| Plantae | Fabaceae | Onobrychis echidna | Ref. |
| Plantae | Fabaceae | Onobrychis ferganica | Ref. |
| Plantae | Fabaceae | Onobrychis grandis | Ref. |
| Plantae | Fabaceae | Onobrychis seravschanica | Ref. |
| Plantae | Fabaceae | Peltophorum africanum  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Styphnolobium japonicum | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fagaceae | Castanea sativa  | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
| Plantae | Geraniaceae | Pelargonium radula | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Haemodoraceae | Anigozanthos pulcherrimus | Ref. |
| Plantae | Haemodoraceae | Anigozanthos rufus | Ref. |
| Plantae | Hydrocharitaceae | Thalassia ciliatum | Ref. |
| Plantae | Hypericaceae | Hypericum ascyron  | Ref. |
| Plantae | Hypericaceae | Hypericum curvisepalum | Ref. |
| Plantae | Hypericaceae | Hypericum elodeoides  | Ref. |
| Plantae | Hypericaceae | Hypericum faberi | Ref. |
| Plantae | Hypericaceae | Hypericum patulum | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum var.angustifolium  | Ref. |
| Plantae | Hypericaceae | Hypericum wightianum | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Labiatae | Ajuga remota  | Ref. |
| Plantae | Labiatae | Leonurus heterophyllus  | Ref. |
| Plantae | Labiatae | Marsypianthes chamaedrys  | Ref. |
| Plantae | Labiatae | Phlomis caucasica | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Stachys palustris L.  | Ref. |
| Plantae | Lauraceae | Cassytha filiformis  | Ref. |
| Plantae | Lauraceae | Lindera megaphylla | Ref. |
| Plantae | Linaceae | Linum austriacum subsp.glaucescens | Ref. |
| Plantae | Linaceae | Linum hirsutum subsp.anatolicum | Ref. |
| Plantae | Linaceae | Linum tenuifolium  | Ref. |
| Plantae | Loranthaceae | Scurrula atropurpurea | Ref. |
| Plantae | Lygodiaceae/Schizaeaceae | Lygodium flexuosum  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Malvaceae | Kleinhovia hospita  | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Meliaceae | Toona sinensis  | Ref. |
| Plantae | Menyanthaceae | Menyanthes trifoliata L.  | Ref. |
| Plantae | Moraceae | Ficus carica  | Ref. |
| Plantae | Moraceae | Ficus pumila  | Ref. |
| Plantae | Moraceae | Ficus ruficaulis Merr.var.antaoensis | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Musaceae | Musa acuminata  | Ref. |
| Plantae | Myrtaceae | Eucalyptus camaldulensis  | Ref. |
| Plantae | Myrtaceae | Eucalyptus globulus  | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Oleaceae | Fraxinus oxycarba | Ref. |
| Plantae | Oleaceae | Olea europaea L.  | Ref. |
| Plantae | Oleaceae | Syringa vulgaris L.  | Ref. |
| Plantae | Onagraceae | Fuchsia fulgens | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Philydraceae | Philydrum lanuginosum | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus acidus  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus niruri  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus urinaria  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Piperaceae | Piper umbellatum  | Ref. |
| Plantae | Plantaginaceae | Plantago argentea | Ref. |
| Plantae | Plantaginaceae | Plantago bellardii | Ref. |
| Plantae | Plantaginaceae | Plantago holosteum | Ref. |
| Plantae | Plantaginaceae | Plantago maritima  | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Podocarpaceae | Podocarpus fasciculus | Ref. |
| Plantae | Polygonaceae | Fagopyrum cymosum  | Ref. |
| Plantae | Polygonaceae | Fagopyrum esculentum  | Ref. |
| Plantae | Polygonaceae | Fagopyrum homotropicum | Ref. |
| Plantae | Polygonaceae | Fagopyrum tataricum  | Ref. |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Polygonaceae | Polygonum spp. | Ref. |
| Plantae | Polygonaceae | Rumex japonicus  | Ref. |
| Plantae | Polygonaceae | Rumex thyrsiflorus  | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Primulaceae | Primula veris  | Ref. |
| Plantae | Ranunculaceae | Thalictrum foetidum  | Ref. |
| Plantae | Rhamnaceae | Berchemia polyphylla var.leioclada | Ref. |
| Plantae | Rhamnaceae | Colubrina asiatica  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rhizophoraceae | Bruguiera sexangula var.rhynchopetala | Ref. |
| Plantae | Rosaceae | Agrimonia pilosa var.japonica  | Ref. |
| Plantae | Rosaceae | Crataegus cuneata  | Ref. |
| Plantae | Rosaceae | Crataegus hupehensis | Ref. |
| Plantae | Rosaceae | Crataegus kansuensis | Ref. |
| Plantae | Rosaceae | Crataegus maximowiczii  | Ref. |
| Plantae | Rosaceae | Crataegus monogyna L.  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida var.major  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida var.psilosa  | Ref. |
| Plantae | Rosaceae | Crataegus sanguinea  | Ref. |
| Plantae | Rosaceae | Crataegus scabrifolia | Ref. |
| Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
| Plantae | Rosaceae | Parageum montanum | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus mume  | Ref. |
| Plantae | Rosaceae | Rosa multiflora  | Ref. |
| Plantae | Rubiaceae | Cruciata taurica | Ref. |
| Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda morindoides | Ref. |
| Plantae | Rubiaceae | Oldenlandia corymbosa | Ref. |
| Plantae | Rubiaceae | Sinoadina racemosa | Ref. |
| Plantae | Rubiaceae | Spermacoce laevis Roxb. | Ref. |
| Plantae | Rubiaceae | Uncaria elliptica | Ref. |
| Plantae | Rubiaceae | Uncaria hirsuta  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Salicaceae | Salix songorica | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Oryctes nevadensis | Ref. |
| Plantae | Solanaceae | Solanum acaule | Ref. |
| Plantae | Solanaceae | Solanum bulbocastanum | Ref. |
| Plantae | Solanaceae | Solanum canasense | Ref. |
| Plantae | Solanaceae | Solanum cardiophyllum | Ref. |
| Plantae | Solanaceae | Solanum fendleri  | Ref. |
| Plantae | Solanaceae | Solanum hougasii | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum paniculatum | Ref. |
| Plantae | Solanaceae | Solanum phureja | Ref. |
| Plantae | Solanaceae | Solanum pinnacritisectum | Ref. |
| Plantae | Solanaceae | Solanum tarijense | Ref. |
| Plantae | Solanaceae | Solanum tuberosum L.  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Turneraceae | Turnera ulmifolia  | Ref. |
| Plantae | Typhaceae | Typha angustata  | Ref. |
| Plantae | Urticaceae | Boehmeria holosericea | Ref. |
| Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
| Plantae | Urticaceae | Urtica dioica  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Centranthus longiflorus ssp. longiflorus | Ref. |
| Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
| Plantae | Verbenaceae | Verbena hybrida | Ref. |
| Plantae | Zingiberaceae | Zingiber mioga  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | Aganosma caryophyllata | Ref. |
| - | - | Echinop ritro | Ref. |
| - | - | First Ruta graveolens | Ref. |
| - | - | Hex aquifolium | Ref. |
| - | - | Macropidia fuliginosa | Ref. |
| - | - | Opunitia dillenii HAW. | Ref. |
| - | - | Scurrura atropurpurea | Ref. |
|
|
zoom in
| Organism | Crataegus kansuensis | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Jia, et al., APS, 27, (1992), 441.
Yao, et al., APS, 28, (1993), 829.
Shi, et al., CCMM, 22, (1997), 743.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Kundakovic, et al., Chem Pharm Bull, 52, (2004), 1462.
Gaitonde, et al., Indian JNP, 4, (1988), 17.
Itoh, et al., JNP, 67, (2004), 427.
Yahara, et al., JNP, 67, (2004), 500.
Chen, et al., JNP, 64, (2001), 990.
Tang, et al., JNP, 64, (2001), 1107.
Kimura, et al., Phytochemistry, 65, (2004), 423.
YUAN, et al., Chem Pharm Bull, 50, (2002), 73.
ZHANG, et al., Chem Pharm Bull, 50, (2002), 841.
QIU, et al., Chem Pharm Bull, 50, (2002), 1507.
OHASHI, et al., Chem Pharm Bull, 51, (2003), 343.
Calixto, et al., Planta Med, 69, (2003), 973.
KANCHANAPOOM, et al., Chem Pharm Bull, 53, (2005), 579.
FURUSAWA, et al., Chem Pharm Bull, 53, (2005), 591.
Ma, et al., JNP, 65, (2002), 206.
Yoshikawa, et al., JNP, 65, (2002), 1151.
Hou, et al., JNP, 66, (2003), 625.
Chang, et al., JNP, 68, (2005), 11.
Tang, et al., Phytochemistry, 58, (2001), 1251.
Heitzman, et al., Phytochemistry, 66, (2005), 5.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chang, et al., Dictionary of Chemistry, Science Press, Beijing, (2008).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|