| Name |
Aphloiol Mangiferin 2-beta-D-Glucopyranosyl-1,3,6,7-tetrahydroxy xanthone |
| Formula |
C19H18O11 |
| Mw |
422.08491142 |
| CAS RN |
4773-96-0 |
| C_ID |
C00002962
, 
|
| InChIKey |
AEDDIBAIWPIIBD-JKQWEQCGNA-N |
| InChICode |
InChI=1S/C19H18O11/c20-4-11-15(25)17(27)18(28)19(30-11)12-8(23)3-10-13(16(12)26)14(24)5-1-6(21)7(22)2-9(5)29-10/h1-3,11,15,17-23,25-28H,4H2/t11-,15-,17+,18-,19+/m1/s1 |
| SMILES |
O=c1c2cc(O)c(O)cc2oc2cc(O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Anacardiaceae | Mangifera persiciformis | Ref. |
| Plantae | Anemarrhenaceae | Anemarrhena asphodeloides Bunge  | Ref. |
| Plantae | Aphloiaceae | Aphloia madagascariensis | Ref. |
| Plantae | Aspleniaceae | Asplenium montanum Willd. | Ref. |
| Plantae | Celastraceae | Salacia prinoides | Ref. |
| Plantae | Davalliaceae | Davallia solida  | Ref. |
| Plantae | Fabaceae | Hedysarum denticulatum | Ref. |
| Plantae | Fabaceae | Hedysarum sericeum | Ref. |
| Plantae | Gentianaceae | Gentiana algida | Ref. |
| Plantae | Gentianaceae | Gentiana campestris | Ref. |
| Plantae | Gentianaceae | Gentiana lutea  | Ref. |
| Plantae | Gentianaceae | Gentiana rhodantha | Ref. |
| Plantae | Gentianaceae | Gentiana triflora | Ref. |
| Plantae | Gentianaceae | Swertia angustifolia  | Ref. |
| Plantae | Gentianaceae | Swertia davidii | Ref. |
| Plantae | Gentianaceae | Swertia mussotii | Ref. |
| Plantae | Hypericaceae | Hypericum ancherii | Ref. |
| Plantae | Hypericaceae | Hypericum sampsonii | Ref. |
| Plantae | Hypericaceae | Hypericum spp. | Ref. |
| Plantae | Iridaceae | Belamcanda chinensis  | Ref. |
| Plantae | Iridaceae | Crocus aureus | Ref. |
| Plantae | Iridaceae | Crocus heuffelianus | Ref. |
| Plantae | Iridaceae | Crocus laevigatus | Ref. |
| Plantae | Iridaceae | Iris florentina | Ref. |
| Plantae | Malpighiaceae | Hiptage madablota | Ref. |
| Plantae | Malvaceae | Bombax malabaricum  | Ref. |
| Plantae | Malvaceae | Urena lobata  | Ref. |
| Plantae | Melianthaceae | Bersama engleriana Gurke | Ref. |
| Plantae | Polypodiaceae | Pyrrosia calvata | Ref. |
| Plantae | Polypodiaceae | Pyrrosia davidii  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia lingua  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia petiolosa  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia prinoides | Ref. |
| Plantae | Polypodiaceae | Pyrrosia pseudocalvata | Ref. |
| Plantae | Polypodiaceae | Pyrrosia sheareri | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Smilacaceae | Smilax bracteata | Ref. |
| Plantae | Thymelaeaceae | Aquilaria sinensis | Ref. |
| Plantae | Thymelaeaceae | Gnidia involucrata  | Ref. |
| Plantae | Thymelaeaceae | Phaleria macrocarpa  | Ref. |
| Plantae | Woodsiaceae/Dryopteridaceae | Athyrium mesosorum | Ref. |
|
|
zoom in
| Organism | Belamcanda chinensis | | Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Si, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 20, (1995), 295.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
KISHI, et al., Chem Pharm Bull, 51, (2003), 1051.
Shahat, et al., Planta Med, 69, (2003), 1068.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|