| Name |
Aloesaponol II |
| Formula |
C15H14O4 |
| Mw |
258.08920894 |
| CAS RN |
53254-92-5 |
| C_ID |
C00064387
|
| InChIKey |
AVKVKSCGQRKETC-LLVKDONJSA-N |
| InChICode |
InChI=1S/C15H14O4/c1-7-2-10(16)4-8-3-9-5-11(17)6-12(18)14(9)15(19)13(7)8/h2-4,11,16-17,19H,5-6H2,1H3/t11-/m1/s1 |
| SMILES |
Cc1cc(O)cc2cc3c(c(O)c12)C(=O)CC(O)C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe sabaea | Ref. |
| Plantae | Asphodelaceae | Aloe saponaria | Ref. |
| Plantae | Asphodelaceae | Aloe vera | Ref. |
|
|
zoom in
| Organism | Aloe saponaria |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
