| Name |
Methylecgonine |
| Formula |
C10H17NO3 |
| Mw |
199.12084342 |
| CAS RN |
7143-09-1 |
| C_ID |
C00051754
|
| InChIKey |
|
| InChICode |
InChI=1S/C10H17NO3/c1-11-6-3-4-7(11)9(8(12)5-6)10(13)14-2/h6-9,12H,3-5H2,1-2H3/t6?,7?,8-,9+/m0/s1 |
| SMILES |
COC(=O)[C@@H]1C2CCC(C[C@@H]1O)N2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum coca  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum novogranatense | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Solanaceae | Datura ceratocaula  | Ref. |
| - | - | Erythoxylum coca | Ref. |
|
|
zoom in
| Organism | Erythroxylum novogranatense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|