| Name |
7-O-Methylaloeresin A |
| Formula |
C29H30O11 |
| Mw |
554.1788118 |
| CAS RN |
329361-25-3 |
| C_ID |
C00036660
, 
|
| InChIKey |
WRLXHKDQSQMWSH-CBRCYODMNA-N |
| InChICode |
InChI=1S/C29H30O11/c1-14-10-20(37-3)24(27-23(14)19(33)12-18(38-27)11-15(2)31)28-29(26(36)25(35)21(13-30)39-28)40-22(34)9-6-16-4-7-17(32)8-5-16/h4-10,12,21,25-26,28-30,32,35-36H,11,13H2,1-3H3/b9-6+/t21-,25-,26+,28+,29-/m1/s1 |
| SMILES |
COc1cc(C)c2c(=O)cc(CC(C)=O)oc2c1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1OC(=O)/C=C/c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe ferox  | Ref. |
| Plantae | Asphodelaceae | Aloe harlans | Ref. |
| Plantae | Asphodelaceae | Aloe hildebrandtii | Ref. |
| Plantae | Asphodelaceae | Aloe marlothii  | Ref. |
|
|
zoom in
| Organism | Aloe harlans | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|