| Name |
(-)-ent-Spathulenol beta-Spathulenol ent-Spathulenol (-)-Spathulenol |
| Formula |
C15H24O |
| Mw |
220.18271539 |
| CAS RN |
77171-55-2 |
| C_ID |
C00031765
, 
|
| InChIKey |
FRMCCTDTYSRUBE-ZZJAXQHVNA-N |
| InChICode |
InChI=1S/C15H24O/c1-9-5-6-11-13(14(11,2)3)12-10(9)7-8-15(12,4)16/h10-13,16H,1,5-8H2,2-4H3/t10-,11-,12-,13+,15-/m1/s1 |
| SMILES |
C=C1CCC2[C@@H]([C@@H]3[C@@H]1CC[C@@]3(C)O)C2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
| Plantae | Asteraceae | Tussilago farfara  | Ref. |
| Plantae | Labiatae | Ocimum americanum  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Eucalyptus resinifera | Ref. |
| Plantae | Plagiochilaceae | Plagiochila fasciculata | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Scapaniaceae | Scapania nemorea | Ref. |
| Plantae | Scapaniaceae | Tritomaria quinquedentata (Huds.) | Ref. |
| - | - | Chiloscyphus subporosus | Ref. |
| - | - | Jackiella javanica | Ref. |
|
|
zoom in
| Organism | Eupatorium adenophorum | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|