| Name |
Lirioferine |
| Formula |
C20H23NO4 |
| Mw |
341.16270823 |
| CAS RN |
6883-42-7 |
| C_ID |
C00028475
, 
|
| InChIKey |
MNYYCWDTJBJERS-YQTOOIBONA-N |
| InChICode |
InChI=1S/C20H23NO4/c1-21-6-5-11-8-17(24-3)20(25-4)19-13-10-15(22)16(23-2)9-12(13)7-14(21)18(11)19/h8-10,14,22H,5-7H2,1-4H3/t14-/m0/s1 |
| SMILES |
COc1cc2c(cc1O)-c1c(OC)c(OC)cc3c1[C@H](C2)N(C)CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr L-Phe |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Xylopia amazonica | Ref. |
| Plantae | Annonaceae | Xylopia aromatica  | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Magnoliaceae | Liriodendron tulipifera  | Ref. |
|
|
zoom in
| Organism | Corydalis yanhusuo | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|