| Name |
N-cis-Coumaroyltyramine N-p-cis-Coumaroyltyramine cis-N-p-Coumaroyltyramine |
| Formula |
C17H17NO3 |
| Mw |
283.12084342 |
| CAS RN |
111129-11-4 |
| C_ID |
C00027418
, 
|
| InChIKey |
RXGUTQNKCXHALN-YHYXMXQVSA-N |
| InChICode |
InChI=1S/C17H17NO3/c19-15-6-1-13(2-7-15)5-10-17(21)18-12-11-14-3-8-16(20)9-4-14/h1-10,19-20H,11-12H2,(H,18,21)/b10-5- |
| SMILES |
O=C(/C=Cc1ccc(O)cc1)NCCc1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium chinense  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia mollissima | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Solanaceae | Capsicum annum | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Datura metel  | Ref. |
|
|
zoom in
| Organism | Aegle marmelos | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|