| Name |
3alpha-Isobutyryloxytropane Butropine |
| Formula |
C12H21NO2 |
| Mw |
211.15722892 |
| CAS RN |
495-80-7 |
| C_ID |
C00025553
, 
|
| InChIKey |
UAINLAXRDPKCOO-URLYPYJENA-N |
| InChICode |
InChI=1S/C12H21NO2/c1-8(2)12(14)15-11-6-9-4-5-10(7-11)13(9)3/h8-11H,4-7H2,1-3H3/t9-,10+,11- |
| SMILES |
CC(C)C(=O)O[C@H]1C[C@H]2CC[C@@H](C1)N2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rhizophoraceae | Bruguiera exaristata Ding Hou | Ref. |
| Plantae | Rhizophoraceae | Bruguiera sexangula (Lour.) poir. | Ref. |
| Plantae | Solanaceae | Atropa baetica | Ref. |
| Plantae | Solanaceae | Cyphanthera albicans (A.Cunn.) Miers ssp.albicans | Ref. |
| Plantae | Solanaceae | Datura innoxia Mill  | Ref. |
| Plantae | Solanaceae | Duboisia leichardtii F.Muell | Ref. |
| Plantae | Solanaceae | Duboisia leichhardtii | Ref. |
| Plantae | Solanaceae | Duboisia myoporoides R.Br.  | Ref. |
|
|
zoom in
| Organism | Atropa baetica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|