| Name |
Uncarine A Isoformosanine |
| Formula |
C21H24N2O4 |
| Mw |
368.17360727 |
| CAS RN |
6899-73-6 |
| C_ID |
C00025217
, 
|
| InChIKey |
JMIAZDVHNCCPDM-VFNJITMSNA-N |
| InChICode |
InChI=1S/C21H24N2O4/c1-12-14-10-23-8-7-21(16-5-3-4-6-17(16)22-20(21)25)18(23)9-13(14)15(11-27-12)19(24)26-2/h3-6,11-14,18H,7-10H2,1-2H3,(H,22,25)/t12-,13+,14-,18+,21+/m1/s1 |
| SMILES |
COC(=O)C1=CO[C@H](C)[C@H]2CN3CC[C@@]4(C(=O)Nc5ccccc54)[C@@H]3C[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Ourouparia formosana | Ref. |
| Plantae | Rubiaceae | Uncaria elliptica R.Br.ex G.Don. | Ref. |
| Plantae | Rubiaceae | Uncaria sinensis  | Ref. |
|
|
zoom in
| Organism | Uncaria sinensis | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|