| Name |
Imbricatolic acid Imbricatoloic acid |
| Formula |
C20H34O3 |
| Mw |
322.25079495 |
| CAS RN |
6832-60-6 |
| C_ID |
C00023300
, 
|
| InChIKey |
NSRKLZRKJJQJLD-FHOGTIDGNA-N |
| InChICode |
InChI=1S/C20H34O3/c1-14(10-13-21)6-8-16-15(2)7-9-17-19(16,3)11-5-12-20(17,4)18(22)23/h14,16-17,21H,2,5-13H2,1,3-4H3,(H,22,23)/t14-,16+,17-,19-,20+/m1/s1 |
| SMILES |
C=C1CCC2[C@](C)(CCC[C@]2(C)C(=O)O)[C@H]1CC[C@@H](C)CCO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Cladoniaceae | Cladonia rangiferina  | Ref. |
| Plantae | Araucariaceae | Araucaria araucana | Ref. |
| Plantae | Pinaceae | Pinus massoniana | Ref. |
|
|
zoom in
| Organism | Pinus massoniana | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|