| Name |
(-)-delta-Cadinol delta-Cadinol (-)-Torreyol Torreyol Cedreanol Sesquigoyol |
| Formula |
C15H26O |
| Mw |
222.19836545 |
| CAS RN |
19435-97-3 |
| C_ID |
C00020150
, 
|
| InChIKey |
LHYHMMRYTDARSZ-OUVVISSWNA-N |
| InChICode |
InChI=1S/C15H26O/c1-10(2)12-7-8-15(4,16)14-6-5-11(3)9-13(12)14/h9-10,12-14,16H,5-8H2,1-4H3/t12-,13+,14-,15+/m0/s1 |
| SMILES |
CC1=C[C@H]2[C@H](C(C)C)CC[C@@](C)(O)[C@H]2CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Chromalveolata | Dictyotaceae | Dictyopteris divaricata | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cupressaceae | Juniperus communis  | Ref. |
| Plantae | Fabaceae | Rhynchosia minima  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Meliaceae | Melia azadirach | Ref. |
| Plantae | Pinaceae | Pinus formosana | Ref. |
| Plantae | Pinaceae | Pinus parviflora | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Petroselinum crispum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|