| Name |
2'-Hydroxydihydrodaidzein 7,2',4'-Trihydroxyisoflavanone |
| Formula |
C15H12O5 |
| Mw |
272.06847349 |
| CAS RN |
75519-15-2 |
| C_ID |
C00009535
, 
|
| InChIKey |
WBOWBLGZAXVREM-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H12O5/c16-8-1-3-10(13(18)5-8)12-7-20-14-6-9(17)2-4-11(14)15(12)19/h1-6,12,16-18H,7H2/t12-/m1/s1 |
| SMILES |
O=C1c2ccc(O)cc2OCC1c1ccc(O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Phaseolus coccineus  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
|
|
zoom in
| Organism | Trifolium repens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|