| Name |
Procyanidin B1 Epicatechin-(4beta->8)-catechin |
| Formula |
C30H26O12 |
| Mw |
578.1424263 |
| CAS RN |
20315-25-7 |
| C_ID |
C00009075
, 
|
| InChIKey |
XFZJEEAOWLFHDH-QYWHNURQNA-N |
| InChICode |
InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26-,27-,28-,29-/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Betulaceae | Betula pubescens  | Ref. |
| Plantae | Cistaceae | Cistus incanus | Ref. |
| Plantae | Cupressaceae | Thujopsis dolobrata | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea bulbifera  | Ref. |
| Plantae | Ericaceae | Pyrola incarnata | Ref. |
| Plantae | Ericaceae | Rhododendron sp. | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea  | Ref. |
| Plantae | Fabaceae | Campylotropis hirella | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fabaceae | Vigna angularis  | Ref. |
| Plantae | Fagaceae | Quercus miyagii | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Cinnamomum cassia Blume.  | Ref. |
| Plantae | Lauraceae | Cinnamomum cirrhosa | Ref. |
| Plantae | Lauraceae | Cinnamomum spp. | Ref. |
| Plantae | Lauraceae | Persea gratissima  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Guazuma ulmifolia  | Ref. |
| Plantae | Malvaceae | Theobroma cacao  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola L.  | Ref. |
| Plantae | Palmae | Areca catechu  | Ref. |
| Plantae | Pinaceae | Larix gmelini | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Polygonaceae | Rheum sp. | Ref. |
| Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
| Plantae | Rosaceae | Crataegus monogyna  | Ref. |
| Plantae | Rosaceae | Crataegus spp. | Ref. |
| Plantae | Rosaceae | Fragaria vesca  | Ref. |
| Plantae | Rosaceae | Malus spp.  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Pyrus spp. | Ref. |
| Plantae | Rosaceae | Rubus spp.  | Ref. |
| Plantae | Rubiaceae | Uncaria gambir  | Ref. |
| Plantae | Rubiaceae | Uncaria sinensis  | Ref. |
| Plantae | Salicaceae | Salix daphnoides | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
| Plantae | Sapotaceae | Sideroxylon inerme L.  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Thujopsis dolobrata | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Chen, et al., Lexicon of Active Componentsin in Plants, Vol 3, Medicinal Science and Technology Press of China, Beijing, (2001).
Hsu, et al., Chem Pharm Bull, 33, (1985), 3293.
Kashiwada, et al., Chem Pharm Bull, 34, (1986), 4083.
Morimoto, et al., Chem Pharm Bull, 34, (1986), 633.
Qin, et al., Chem Abstr, 116, (1992), 21112x.
Yazaki, et al., Phytochemistry, 28, (1989), 607.
Agriga, et al., Agric Biol Chem, 52, (1988), 2717.
Ozo, et al., Phytochemistry, 23, 81984), 329.
Morimoto, et al., Chem Pharm Bull, 36, (1988), 33.
Liu, et al., Zhongguo Yaowu Huaxue Zazhi, 14, (2004), 193.
Heitzman, et al., Phytochemistry, 66, (2005), 5 |
|---|
|