| Name |
Sulfurein |
| Formula |
C21H20O10 |
| Mw |
432.10564686 |
| CAS RN |
531-63-5 |
| C_ID |
C00008043
, 
|
| InChIKey |
MEHCTOVFPFJFEW-OHPGNTIMNA-N |
| InChICode |
InChI=1S/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-10-2-3-11-14(7-10)30-15(17(11)25)6-9-1-4-12(23)13(24)5-9/h1-7,16,18-24,26-28H,8H2/b15-6-/t16-,18-,19+,20-,21-/m1/s1 |
| SMILES |
O=C1C(=Cc2ccc(O)c(O)c2)Oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)ccc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Cotinus coggygria | Ref. |
| Plantae | Asteraceae | Baeria chrysostoma | Ref. |
| Plantae | Asteraceae | Bidens spp. | Ref. |
| Plantae | Asteraceae | Coreopsis spp. | Ref. |
| Plantae | Asteraceae | Dahlia variabilis  | Ref. |
| Plantae | Asteraceae | Simsia spp. | Ref. |
| Plantae | Asteraceae | Tithonia koelzii | Ref. |
| Plantae | Asteraceae | Viguiera multiflora | Ref. |
| Plantae | Fabaceae | Butea monosperma  | Ref. |
| Plantae | Oleaceae | Jasminum officinale  | Ref. |
|
|
zoom in
| Organism | Bidens spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Shimokoriyama,J.Am.Chem.Soc.,75,(1953),1900
Geissman,J.Am.Chem.Soc.,78,(1956),825 |
|---|
|