| Name |
Lucenin 2
Luteolin 6,8-C-diglucoside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
29428-58-8 |
| C_ID |
C00006231
, 
|
| InChIKey |
ZLPSOQFIIQIIAX-ZYYYSNSLNA-N |
| InChICode |
InChI=1S/C27H30O16/c28-5-12-17(33)21(37)23(39)26(42-12)15-19(35)14-10(32)4-11(7-1-2-8(30)9(31)3-7)41-25(14)16(20(15)36)27-24(40)22(38)18(34)13(6-29)43-27/h1-4,12-13,17-18,21-24,26-31,33-40H,5-6H2/t12-,13+,17-,18-,21+,22+,23-,24-,26+,27+/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O)c(O)c2)oc2c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Carlina corymbosa  | Ref. |
| Plantae | Asteraceae | Tragopogon spp. | Ref. |
| Plantae | Burseraceae | Hedwigia ciliata | Ref. |
| Plantae | Caryophyllaceae | Spergularia rubra | Ref. |
| Plantae | Fabaceae | Sophora spp. | Ref. |
| Plantae | Labiatae | Salvia aegypteacae | Ref. |
| Plantae | Labiatae | Vitex lucens | Ref. |
| Plantae | Linaceae | Linum usitatissimum | Ref. |
| Plantae | Poaceae | Triticum aestivum | Ref. |
| Plantae | Rosaceae | Cydonia oblonga | Ref. |
| Plantae | Rutaceae | Citrus aurantium | Ref. |
|
|
zoom in
| Organism | Hedwigia ciliata |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Sekel,Phytochem.,5,(1966),439 |
|---|
|
