| Name |
Reynoutrin |
| Formula |
C20H18O11 |
| Mw |
434.08491142 |
| CAS RN |
6743-88-0 |
| C_ID |
C00005370
, 
|
| InChIKey |
PZZRDJXEMZMZFD-LJDZMODXNA-N |
| InChICode |
InChI=1S/C20H18O11/c21-8-4-11(24)14-13(5-8)30-18(7-1-2-9(22)10(23)3-7)19(16(14)27)31-20-17(28)15(26)12(25)6-29-20/h1-5,12,15,17,20-26,28H,6H2/t12-,15+,17-,20+/m0/s1 |
| SMILES |
O=c1c(O[C@@H]2OC[C@@H](O)C(O)C2O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Begoniaceae | Begonia glaucophylla | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum spp. | Ref. |
| Plantae | Euphorbiaceae | Ricinus communis  | Ref. |
| Plantae | Geraniaceae | Geranium niveum | Ref. |
| Plantae | Iridaceae | Patersonia maxwellii | Ref. |
| Plantae | Lythraceae | Woodfordia fruticosa  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Polygalaceae | Securidaca diversifolia  | Ref. |
| Plantae | Polygonaceae | Reynoutria japonoca | Ref. |
| Plantae | Rosaceae | Rosa multiflora  | Ref. |
| Plantae | Saxifragaceae | Heuchera spp. | Ref. |
| Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
| Plantae | Saxifragaceae | Saxifraga ferruginea | Ref. |
| Plantae | Solanaceae | Solanum spp. | Ref. |
| Plantae | Velloziaceae | Aylthonia riedeliana | Ref. |
|
|
zoom in
| Organism | Ricinus communis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Nakaoki,Pharm.Soc.Japan,78,(1958),521
Horhammer,Tetrahedron Lett.,(1966),567 |
|---|
|