| Name |
Melanoxetin 3,7,8,3',4'-Pentahydroxyflavone 2-(3,4-Dihydroxyphenyl)-3,7,8-trihydroxy-4H-1-benzopyran-4-one |
| Formula |
C15H10O7 |
| Mw |
302.04265268 |
| CAS RN |
489-58-7 |
| C_ID |
C00004660
, 
|
| InChIKey |
RHTZDFORBKRGQU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O7/c16-8-3-1-6(5-10(8)18)14-13(21)11(19)7-2-4-9(17)12(20)15(7)22-14/h1-5,16-18,20-21H |
| SMILES |
O=c1c(O)c(-c2ccc(O)c(O)c2)oc2c(O)c(O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia confusa | Ref. |
| Plantae | Fabaceae | Acacia karroo  | Ref. |
| Plantae | Fabaceae | Acacia melanoxylon  | Ref. |
| Plantae | Fabaceae | Acacia montana | Ref. |
| Plantae | Fabaceae | Acacia nigrescens | Ref. |
| Plantae | Fabaceae | Albizia adianthifolia  | Ref. |
| Plantae | Fabaceae | Albizia lebbek | Ref. |
|
|
zoom in
| Organism | Acacia melanoxylon | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Clark-Lewis,J.Chem.Soc.,(1960),4106 |
|---|
|