| Name |
Lophenol |
| Formula |
C28H48O |
| Mw |
400.37051615 |
| CAS RN |
481-25-4 |
| C_ID |
C00003659
, 
|
| InChIKey |
LMYZQUNLYGJIHI-YOSZJMIINA-N |
| InChICode |
InChI=1S/C28H48O/c1-18(2)8-7-9-19(3)22-12-13-24-21-10-11-23-20(4)26(29)15-17-28(23,6)25(21)14-16-27(22,24)5/h10,18-20,22-26,29H,7-9,11-17H2,1-6H3/t19-,20+,22-,23+,24+,25+,26+,27-,28+/m1/s1 |
| SMILES |
CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@H]4[C@H](C)[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe sabaea | Ref. |
| Plantae | Asphodelaceae | Aloe saponaria  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Cactaceae | Lophocereus schottii | Ref. |
| Plantae | Ranunculaceae | Nigella sativa  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| - | - | Crotone hieronymi | Ref. |
|
|
zoom in
| Organism | Aloe saponaria | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|