| Name |
Aucuparin |
| Formula |
C14H14O3 |
| Mw |
230.09429431 |
| CAS RN |
3687-28-3 |
| C_ID |
C00002980
, 
|
| InChIKey |
KCKBEANTNJGRCV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H14O3/c1-16-12-8-11(9-13(17-2)14(12)15)10-6-4-3-5-7-10/h3-9,15H,1-2H3 |
| SMILES |
COc1cc(-c2ccccc2)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Berberis koreana | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia linii | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia schomburgkiana | Ref. |
| Plantae | Clusiaceae-Guttiferae | Kielmeyera coriacea | Ref. |
| Plantae | Rosaceae | Eriobotrya japonica  | Ref. |
| Plantae | Rosaceae | Malus x domestica cv. | Ref. |
| Plantae | Rosaceae | Sorbus aucuparia  | Ref. |
| Plantae | Rosaceae | Sorbus decora  | Ref. |
|
|
zoom in
| Organism | Garcinia schomburgkiana | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|