| Name |
Ptaeroglycol |
| Formula |
C15H14O6 |
| Mw |
290.07903818 |
| CAS RN |
18836-12-9 |
| C_ID |
C00002442
, 
|
| InChIKey |
IVVDHMXDSFGHMC-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H14O6/c1-8-4-10(17)13-12(21-8)5-11-9(14(13)18)2-3-15(19,6-16)7-20-11/h2-5,16,18-19H,6-7H2,1H3/t15-/m0/s1 |
| SMILES |
Cc1cc(=O)c2c(O)c3c(cc2o1)OCC(O)(CO)C=C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Pterodon obliquum | Ref. |
| Plantae | Meliaceae | Cedrelopsis grevei | Ref. |
| Plantae | Rutaceae | Cneorum pulverulentum | Ref. |
| Plantae | Rutaceae | Cneorum tricoccum | Ref. |
| Plantae | Rutaceae | Ptaeroxylon obliquum  | Ref. |
|
|
zoom in
| Organism | Cneorum pulverulentum | | Reference | Buckingham, et al., Dictionary of Org Compds. 5th ed., London, Chapman & Hall, (1982).
Dean, et al., Tetrahedron Lett, (1967), 3459.
Mondon, et al., Chem Ber, 108, (1975), 2005.
Gonzalez, et al., Planta Med, 47, (1983), 56
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter34 |
|---|
|