| Name |
Isocitric acid |
| Formula |
C6H8O7 |
| Mw |
192.02700261 |
| CAS RN |
6061-97-8 |
| C_ID |
C00001188
, 
|
| InChIKey |
ODBLHEXUDAPZAU-ATZVLOMYNA-N |
| InChICode |
InChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/t2-,4+/m0/s1 |
| SMILES |
O=C(O)C[C@H](C(=O)O)[C@@H](O)C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Crassulaceae | Bryophyllum calycinum  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Rubus spp.  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Panax ginseng | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|