| Name |
Citral Citral (E/Z) |
| Formula |
C10H16O |
| Mw |
152.12011513 |
| CAS RN |
5392-40-5 |
| C_ID |
C00035822
, 
|
| InChIKey |
WTEVQBCEXWBHNA-JXMROGBWSA-N |
| InChICode |
InChI=1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7+ |
| SMILES |
CC(C)=CCC/C(C)=C/C=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Daucus carota var.sativa  | Ref. |
| Plantae | Apocynaceae | Alstonia scholaris  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Labiatae | Dracocephalum moldavica  | Ref. |
| Plantae | Labiatae | Dracocephalum moldavicum  | Ref. |
| Plantae | Labiatae | Perilla frutescens var.crispa  | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Lauraceae | Litsea verbena | Ref. |
| Plantae | Magnoliaceae | Magnolia liliflora  | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Poaceae | Cymbopogon flexuosus  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Polygonaceae | Polygonum odoratum  | Ref. |
| Plantae | Rosaceae | Prunus armeniaca  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus limonia  | Ref. |
| Plantae | Rutaceae | Citrus medica  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
| Plantae | Verbenaceae | Verbena triphylla | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Seriphidium cinum | Ref. |
|
|
zoom in
| Organism | Citrus medica | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|