| Name |
Chrysosplenol D 5,3',4'-Trihydroxy-3,6,7-trimethoxyflavone Quercetagetin 3,6,7-Trimethyl ether 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
14965-20-9 |
| C_ID |
C00004692
, 
|
| InChIKey |
BYWLLSQTJBXAPV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-12-7-11-13(14(21)17(12)24-2)15(22)18(25-3)16(26-11)8-4-5-9(19)10(20)6-8/h4-7,19-21H,1-3H3 |
| SMILES |
COc1cc2oc(-c3ccc(O)c(O)c3)c(OC)c(=O)c2c(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea clusiana | Ref. |
| Plantae | Asteraceae | Ageratina havanensis | Ref. |
| Plantae | Asteraceae | Ajania fruticulosa  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia australis | Ref. |
| Plantae | Asteraceae | Artemisia mongolica | Ref. |
| Plantae | Asteraceae | Blumea malcomii | Ref. |
| Plantae | Asteraceae | Brickellia eupatorioides | Ref. |
| Plantae | Asteraceae | Flourensia cernua | Ref. |
| Plantae | Asteraceae | Hemizonia lutescens | Ref. |
| Plantae | Asteraceae | Heterotheca villosa | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Inula germanica  | Ref. |
| Plantae | Asteraceae | Madia sativa  | Ref. |
| Plantae | Asteraceae | Oncosiphon grandiflorum | Ref. |
| Plantae | Asteraceae | Pulicaria gnaphaloides  | Ref. |
| Plantae | Asteraceae | Tanacetum polycephalum | Ref. |
| Plantae | Hydrophyllaceae | Eriodictyon trichocalyx | Ref. |
| Plantae | Labiatae | Cyanostegia microphylla | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Rosaceae | Rosa centifolia  | Ref. |
| Plantae | Saxifragaceae | Chrysosplenium tosaense | Ref. |
|
|
zoom in
| Organism | Origanum majorana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|