| Name |
Octadecanoic acid Stearic acid |
| Formula |
C18H36O2 |
| Mw |
284.27153039 |
| CAS RN |
57-11-4 |
| C_ID |
C00001238
, 
|
| InChIKey |
QIQXTHQIDYTFRH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-17H2,1H3,(H,19,20) |
| SMILES |
CCCCCCCCCCCCCCCCCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Fungi | Clavicipitaceae | Cordyceps sinensis  | Ref. |
| Plantae | Acanthaceae | Justicia heterocarpa T.ANDERS  | Ref. |
| Plantae | Alliaceae | Allium hirtifolium | Ref. |
| Plantae | Amaranthaceae | Celosia cristada | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Apiaceae | Bupleurum chinense | Ref. |
| Plantae | Apiaceae | Heracleum yungningense | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Apiaceae | Peucedanum govanianum var.bicolo | Ref. |
| Plantae | Apiaceae | Peucedanum rubricaule | Ref. |
| Plantae | Araceae | Colocasia esculenta  | Ref. |
| Plantae | Araliaceae | Acanthopanax gracilistylus  | Ref. |
| Plantae | Araliaceae | Acanthopanax senticosus  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Araliaceae | Panax quinquefolium  | Ref. |
| Plantae | Asphodelaceae | Aloe vera var.chinensis  | Ref. |
| Plantae | Aspleniaceae | Asplenium laciniatum | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia capillaris  | Ref. |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Silybum marianum  | Ref. |
| Plantae | Berberidaceae | Epimedium brevicornum  | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Drymaria cordata  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica hirta  | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. italica  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes kirilowii  | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes rosthornii  | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Euphorbiaceae | Croton tiglium  | Ref. |
| Plantae | Euphorbiaceae | Jatropha curcus | Ref. |
| Plantae | Fabaceae | Cassia absu | Ref. |
| Plantae | Fabaceae | Cassia alata  | Ref. |
| Plantae | Fabaceae | Cassia javanica  | Ref. |
| Plantae | Fabaceae | Cassia multijuga | Ref. |
| Plantae | Fabaceae | Clitoria ternata | Ref. |
| Plantae | Fabaceae | Desmodium styracifolium  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Mucuna puriens | Ref. |
| Plantae | Fabaceae | Pongamia pinnata  | Ref. |
| Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
| Plantae | Jubulaceae | Frullania incumbens | Ref. |
| Plantae | Jubulaceae | Frullania lobulata | Ref. |
| Plantae | Labiatae | Anisomeles indica  | Ref. |
| Plantae | Labiatae | Callicarpa pilosissima | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Vitex trifolia  | Ref. |
| Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
| Plantae | Lauraceae | Cinnamomum tenuifolium | Ref. |
| Plantae | Liliaceae | Fritillaria unibracteata  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Melanthiaceae | Veratrum album  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
| Plantae | Oleaceae | Jasminum auriculatum  | Ref. |
| Plantae | Orobanchaceae | Cistanche deserticola  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Palmae | Areca catechu  | Ref. |
| Plantae | Pandanaceae | Pandanus conoideus Lam  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Piperaceae | Piper betle  | Ref. |
| Plantae | Piperaceae | Piper nigrum L.  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Primulaceae | Primula ovalifolia | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida  | Ref. |
| Plantae | Rosaceae | Prunus armeniaca  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum L.  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera Meerb.  | Ref. |
| Plantae | Scrophulariaceae | Diascia cordata | Ref. |
| Plantae | Scrophulariaceae | Diascia integerrima | Ref. |
| Plantae | Scrophulariaceae | Diascia megathura | Ref. |
| Plantae | Scrophulariaceae | Diascia purpurea | Ref. |
| Plantae | Scrophulariaceae | Diascia vigilis | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Simaroubaceae | Brucea javanica  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
| Plantae | Typhaceae | Typha angustata  | Ref. |
| Plantae | Urticaceae | Boehmeria holosericea | Ref. |
| Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
| Plantae | Verbenaceae | Lantana camara  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| - | - | Bergera koenegii | Ref. |
| - | - | Buthus martensi | Ref. |
| - | - | Curcurbita pepo L. | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Sebastiana sebiferum | Ref. |
|
|
zoom in
| Organism | Aloe vera var.chinensis | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Rao, et al., APS, 26, (1991), 30.
Yang, et al., APS, 28, (1993), 197.
Zhao, et al., CCMM, 18, (1993), 428.
Rao, et al., CCMM, 18, (1993), 681.
Rao, et al., CCMM, 20, (1995), 740.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
TORIUMI, et al., Chem Pharm Bull, 51, (2003), 89.
Carcache-Blanco, et al., JNP, 66, (2003), 1197.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|