| Name |
3alpha-Acetoxytropane
Acetyltropine O-Acetyltropine Tropan-3a-ol acetate (ester) Tropine acetate (ester) Tropyl acetate endo-3-Acetoxy-8-methyl-8-azabicyclo[3.2.1]octane |
| Formula |
C10H17NO2 |
| Mw |
183.12592879 |
| CAS RN |
3423-27-6 |
| C_ID |
C00025551
, 
|
| InChIKey |
MDIDMOWWLBGYPG-MYJAWHEDNA-N |
| InChICode |
InChI=1S/C10H17NO2/c1-7(12)13-10-5-8-3-4-9(6-10)11(8)2/h8-10H,3-6H2,1-2H3/t8-,9+,10- |
| SMILES |
CC(=O)O[C@H]1C[C@H]2CC[C@@H](C1)N2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rhizophoraceae | Bruguiera exaristata Ding Hou | Ref. |
| Plantae | Rhizophoraceae | Bruguiera sexangula (Lour.) poir. | Ref. |
| Plantae | Solanaceae | Anthotroche myoporoides C.A.Gardn | Ref. |
| Plantae | Solanaceae | Anthotroche walcottii F.Muell | Ref. |
| Plantae | Solanaceae | Cyphanthera albicans (A.Cunn.) Miers ssp.albicans | Ref. |
| Plantae | Solanaceae | Datura candida X candida  | Ref. |
| Plantae | Solanaceae | Datura discolor Bernh | Ref. |
| Plantae | Solanaceae | Datura ferox L.  | Ref. |
| Plantae | Solanaceae | Datura innoxia Mill  | Ref. |
| Plantae | Solanaceae | Datura metel L.var.fastuosa(Bernh.)Danert  | Ref. |
| Plantae | Solanaceae | Datura quercifolia H.B.K. | Ref. |
| Plantae | Solanaceae | Datura sanguinea R.and P. | Ref. |
| Plantae | Solanaceae | Datura stramonium L.  | Ref. |
| Plantae | Solanaceae | Datura suaveolens H.and B.ex Willd | Ref. |
| Plantae | Solanaceae | Datura wrightii Regel | Ref. |
| Plantae | Solanaceae | Duboisia myoporoides R.Br.  | Ref. |
| Plantae | Solanaceae | Grammosolen dixonii (F.Muell.et R.Tate)Haegi | Ref. |
| Plantae | Solanaceae | Hyoscyamus albus L.  | Ref. |
| Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
| Plantae | Solanaceae | Hyoscyamus desertorum Tackh | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus pusillus L. | Ref. |
| Plantae | Solanaceae | Solandra grandiflora Sw. | Ref. |
| Plantae | Solanaceae | Solandra guttata D.Don ex Lindley | Ref. |
| Plantae | Solanaceae | Solandra hirsuta Dun | Ref. |
| Plantae | Solanaceae | Solandra macrocantha Dun | Ref. |
|
|
zoom in
| Organism | Hyoscyamus boveanus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|