| Name |
(+)-Pinoresinol Pinoresinol |
| Formula |
C20H22O6 |
| Mw |
358.14163844 |
| CAS RN |
487-36-5 |
| C_ID |
C00007190
, 
|
| InChIKey |
HGXBRUKMWQGOIE-RBNFTNMJNA-N |
| InChICode |
InChI=1S/C20H22O6/c1-23-17-7-11(3-5-15(17)21)19-13-9-26-20(14(13)10-25-19)12-4-6-16(22)18(8-12)24-2/h3-8,13-14,19-22H,9-10H2,1-2H3/t13-,14-,19+,20+/m0/s1 |
| SMILES |
COc1cc(C2OC[C@@H]3[C@@H](c4ccc(O)c(OC)c4)OC[C@H]23)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterococcaceae | Enterococcus faecalis  | Ref. |
| Plantae | Acanthaceae | Justicia diffusa var. prostrata | Ref. |
| Plantae | Actinidiaceae | Actinidia arguta  | Ref. |
| Plantae | Adoxaceae | Sambucus nigra  | Ref. |
| Plantae | Annonaceae | Goniothalamus amuyon | Ref. |
| Plantae | Apiaceae | Angelica furcijuga | Ref. |
| Plantae | Apiaceae | Bupleurum salicifolium | Ref. |
| Plantae | Apiaceae | Oenanthe javanica  | Ref. |
| Plantae | Apocynaceae | Allamanda neriifolia | Ref. |
| Plantae | Apocynaceae | Allamanda schottii | Ref. |
| Plantae | Apocynaceae | Himatanthus fallax | Ref. |
| Plantae | Apocynaceae | Poacynum hendersonii | Ref. |
| Plantae | Apocynaceae | Strophanthus gratus  | Ref. |
| Plantae | Araceae | Arum italicum  | Ref. |
| Plantae | Araceae | Rhaphidophora decursiva  | Ref. |
| Plantae | Araceae | Zantedeschia aethiopica  | Ref. |
| Plantae | Araliaceae | Aralia bipinnata | Ref. |
| Plantae | Araliaceae | Eleutherococcus senticosus  | Ref. |
| Plantae | Araucariaceae | Araucaria angustifolia | Ref. |
| Plantae | Asteraceae | Ageratina ligustrina | Ref. |
| Plantae | Asteraceae | Arnica mollis | Ref. |
| Plantae | Asteraceae | Carduus assoi | Ref. |
| Plantae | Asteraceae | Carduus tenuiflorus  | Ref. |
| Plantae | Asteraceae | Mikania saltensis | Ref. |
| Plantae | Asteraceae | Onopordum acanthium  | Ref. |
| Plantae | Asteraceae | Onopordum caricum | Ref. |
| Plantae | Asteraceae | Pluchea indica  | Ref. |
| Plantae | Asteraceae | Pluchea quitoc | Ref. |
| Plantae | Asteraceae | Saussurea medusa | Ref. |
| Plantae | Asteraceae | Scorzonera hispanica  | Ref. |
| Plantae | Balanophoraceae | Balanophora abbreviata B1 | Ref. |
| Plantae | Balanophoraceae | Balanophora harlandii | Ref. |
| Plantae | Balanophoraceae | Balanophora latisepala | Ref. |
| Plantae | Celastraceae | Bhesa paniculata  | Ref. |
| Plantae | Convallariaceae | Polygonatum sibiricum  | Ref. |
| Plantae | Convolvulaceae | Cuscuta chinensis  | Ref. |
| Plantae | Cupressaceae | Thuja occidentalis  | Ref. |
| Plantae | Dilleniaceae | Doliocarpus dentatus  | Ref. |
| Plantae | Dipsacaceae | Morina chinensis  | Ref. |
| Plantae | Ericaceae | Rhododendron przewalskii | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia pekinensis  | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Gentianaceae | Fagraea racemosa | Ref. |
| Plantae | Icacinaceae | Poraqueiba paraensis | Ref. |
| Plantae | Labiatae | Leonurus sibiricus  | Ref. |
| Plantae | Linaceae | Hugonia tomentosa | Ref. |
| Plantae | Linaceae | Linum scabrellum | Ref. |
| Plantae | Linaceae | Linum usitatissimum  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Liriodendron tulipfera | Ref. |
| Plantae | Magnoliaceae | Liriodendron tulipifera  | Ref. |
| Plantae | Magnoliaceae | Magnolia coco | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia fargesii  | Ref. |
| Plantae | Magnoliaceae | Magnolia kobus var. borealis  | Ref. |
| Plantae | Magnoliaceae | Magnolia salicifolia  | Ref. |
| Plantae | Malvaceae | Helicteres angustifolia  | Ref. |
| Plantae | Malvaceae | Hibiscus cannabinus  | Ref. |
| Plantae | Myoporaceae | Eremophila maculata var. brevifolia  | Ref. |
| Plantae | Myrtaceae | Eucalyptus globulus  | Ref. |
| Plantae | Oleaceae | Chionanthus retusus | Ref. |
| Plantae | Oleaceae | Forsythia europaea | Ref. |
| Plantae | Oleaceae | Forsythia giraldiana | Ref. |
| Plantae | Oleaceae | Forsythia intermedia | Ref. |
| Plantae | Oleaceae | Forsythia japonica | Ref. |
| Plantae | Oleaceae | Forsythia koreana | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Oleaceae | Fraxinus japonica  | Ref. |
| Plantae | Oleaceae | Fraxinus mandshurica var. japonica  | Ref. |
| Plantae | Oleaceae | Jasminum simplicifolium | Ref. |
| Plantae | Oleaceae | Ligustrum obtusifolium  | Ref. |
| Plantae | Oleaceae | Ligustrum ovalifolium | Ref. |
| Plantae | Oleaceae | Osmanthus asiaticus | Ref. |
| Plantae | Oleaceae | Syringa reticulata | Ref. |
| Plantae | Oleaceae | Syringa vulgaris  | Ref. |
| Plantae | Orchidaceae | Bulbophyllum triste | Ref. |
| Plantae | Orchidaceae | Ephemerantha fimbriata | Ref. |
| Plantae | Orobanchaceae | Boschniakia rossica | Ref. |
| Plantae | Orobanchaceae | Cistanche salsa | Ref. |
| Plantae | Orobanchaceae | Cistanche tubulosa  | Ref. |
| Plantae | Pandanaceae | Pandanus odoratissimus  | Ref. |
| Plantae | Pedaliaceae | Sesamum indicum  | Ref. |
| Plantae | Pinaceae | Abies koreana | Ref. |
| Plantae | Pinaceae | Abies sachalinensis | Ref. |
| Plantae | Pinaceae | Larix dahurica | Ref. |
| Plantae | Pinaceae | Larix decidua  | Ref. |
| Plantae | Pinaceae | Larix leptolepis | Ref. |
| Plantae | Pinaceae | Larix sibirica | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Picea glehnii | Ref. |
| Plantae | Pinaceae | Picea jezoensis | Ref. |
| Plantae | Pinaceae | Picea obovata | Ref. |
| Plantae | Pinaceae | Pinus massoniana | Ref. |
| Plantae | Pinaceae | Tsuga heterophylla  | Ref. |
| Plantae | Piperaceae | Peperomia sui | Ref. |
| Plantae | Poaceae | Festuca argentina | Ref. |
| Plantae | Ranunculaceae | Clematis stans | Ref. |
| Plantae | Ranunculaceae | Coptis japonica var. dissecta  | Ref. |
| Plantae | Ranunculaceae | Pulsatilla chinensis  | Ref. |
| Plantae | Rosaceae | Rosa multiflora  | Ref. |
| Plantae | Rosaceae | Rubus amabilis | Ref. |
| Plantae | Rubiaceae | Tarenna attenuata | Ref. |
| Plantae | Rubiaceae | Tricalysia dubia | Ref. |
| Plantae | Rutaceae | Zanthoxylum ailanthoides | Ref. |
| Plantae | Rutaceae | Zanthoxylum kellermanii | Ref. |
| Plantae | Scrophulariaceae | Aptosimum spinescens | Ref. |
| Plantae | Simaroubaceae | Leitneria floridana | Ref. |
| Plantae | Solanaceae | Brunfelsia hopeana | Ref. |
| Plantae | Symplocaceae | Symplocos lancifolia | Ref. |
| Plantae | Symplocaceae | Symplocos lucida | Ref. |
| Plantae | Taxaceae | Taxus cuspidata  | Ref. |
| Plantae | Taxaceae | Taxus mairei  | Ref. |
| Plantae | Taxaceae | Torreya jackii | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
| Plantae | Thymelaeaceae | Daphne acutiloba | Ref. |
| Plantae | Thymelaeaceae | Daphne genkwa  | Ref. |
| Plantae | Thymelaeaceae | Daphne mezereum  | Ref. |
| Plantae | Thymelaeaceae | Daphne odora  | Ref. |
| Plantae | Thymelaeaceae | Daphne oleoides spp.  | Ref. |
| Plantae | Thymelaeaceae | Daphne pseudomezereum | Ref. |
| Plantae | Thymelaeaceae | Daphne tangutica | Ref. |
| Plantae | Thymelaeaceae | Stellera chamaejasme  | Ref. |
| Plantae | Thymelaeaceae | Wikstroemia sikokiana | Ref. |
| Plantae | Thymelaeaceae | Wikstroemia viridiflora | Ref. |
| Plantae | Urticaceae | Urtica dioica  | Ref. |
| Plantae | Valerianaceae | Nardostachys jatamansi  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| - | - | Selaginella sinensis | Ref. |
|
|
zoom in
| Organism | Araucaria angustifolia | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Hosokawa, et al., Chem Pharm Bull, 52, (2004), 1265.
Calixto, et al., Planta Med, 70, (2004), 93.
XIE, et al., Chem Pharm Bull, 53, (2005), 1416.
Lan, et al., JNP, 66, (2003), 487.
Tanaka, et al., Planta Med, 70, (2004), 877.
D'Abrosca, et al., Phytochemistry, 58, (2001), 1073.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009)
Umezawa,Phytochem.Rev.,2,(2003),371
Umezawa,Wood Res.,No.90,(2003),27 |
|---|
|