| Name |
Aesculetin Esculetin 6,7-Dihydroxycoumarin |
| Formula |
C9H6O4 |
| Mw |
178.02660868 |
| CAS RN |
305-01-1 |
| C_ID |
C00002471
, 
|
| InChIKey |
ILEDWLMCKZNDJK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H6O4/c10-6-3-5-1-2-9(12)13-8(5)4-7(6)11/h1-4,10-11H |
| SMILES |
O=c1ccc2cc(O)c(O)cc2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera gracilipes var. glandulosa | Ref. |
| Plantae | Apocynaceae | Periploca graeca  | Ref. |
| Plantae | Araliaceae | Aralia fargesii | Ref. |
| Plantae | Asphodelaceae | Asphodeline globifera | Ref. |
| Plantae | Asteraceae | Bidens tripartita  | Ref. |
| Plantae | Asteraceae | Cichorium intybus  | Ref. |
| Plantae | Asteraceae | Haplopappus foliosus | Ref. |
| Plantae | Asteraceae | Koelpinia linearis | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Crassulaceae | Sedum ewersii | Ref. |
| Plantae | Crassulaceae | Sedum kamtschaticum  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Ericaceae | Erica vagans | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lanata | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lathyris  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lunulata  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Melilotus suaveolens  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Meehania urticifolia | Ref. |
| Plantae | Labiatae | Salvia euphratica | Ref. |
| Plantae | Meliaceae | Khaya ivorensis  | Ref. |
| Plantae | Meliaceae | Khaya senegalensis L.  | Ref. |
| Plantae | Oleaceae | Fraxinus bungeana | Ref. |
| Plantae | Oleaceae | Fraxinus chinensis  | Ref. |
| Plantae | Oleaceae | Fraxinus mandshurica  | Ref. |
| Plantae | Oleaceae | Fraxinus ornus  | Ref. |
| Plantae | Oleaceae | Fraxinus paxiana | Ref. |
| Plantae | Oleaceae | Fraxinus rhynchophylla  | Ref. |
| Plantae | Oleaceae | Fraxinus spp. | Ref. |
| Plantae | Oleaceae | Fraxinus stylosa  | Ref. |
| Plantae | Oleaceae | Fraxinus szaboana  | Ref. |
| Plantae | Plumbaginaceae | Ceratostigma willmottianum | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus limonia  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
| Plantae | Sapindaceae | Aesculus turbinata  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Solanaceae | Anisodus tanguticus | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum xanthocarpum  | Ref. |
|
|
zoom in
| Organism | Trifolium pratense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|