| Name |
(+)-Limonene (+)-(R)-limonene D-Limonene (+)-S-Carvone d-(+)-Limonene |
| Formula |
C10H16 |
| Mw |
136.12520051 |
| CAS RN |
5989-27-5 |
| C_ID |
C00010868
, 
|
| InChIKey |
XMGQYMWWDOXHJM-UEQNJFAPNA-N |
| InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| SMILES |
C=C(C)[C@H]1CC=C(C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Anethum graveolens  | Ref. |
| Plantae | Apiaceae | Anethum spp. | Ref. |
| Plantae | Apiaceae | Bupleurum chinense | Ref. |
| Plantae | Apiaceae | Carum carvi L.  | Ref. |
| Plantae | Apiaceae | Coriandrum sativum  | Ref. |
| Plantae | Apiaceae | Cryptotaenia japonica | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Notopterygium forbesii  | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Aristolochiaceae | Asarum heterotropoides var.mandshuricum | Ref. |
| Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia capillaris  | Ref. |
| Plantae | Asteraceae | Echinops grijsii | Ref. |
| Plantae | Burseraceae | Boswellia carterii | Ref. |
| Plantae | Burseraceae | Commiphora mukul  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Ericaceae | Rhododendron anthopogonoides | Ref. |
| Plantae | Fabaceae | Colophospermum mopane  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
| Plantae | Hamamelidaceae | Liquidambar formosana  | Ref. |
| Plantae | Labiatae | Agastache rugosus | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Mentha haplocalyx  | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Mosla dianthera  | Ref. |
| Plantae | Labiatae | Ocimum americanum  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Ocimum gratissimum  | Ref. |
| Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
| Plantae | Labiatae | Ocimum sanctum  | Ref. |
| Plantae | Labiatae | Ocimum tenuiflorum  | Ref. |
| Plantae | Labiatae | Perilla frutescens var.acuta  | Ref. |
| Plantae | Labiatae | Perilla frutescens var.crispa  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Schizonepeta tenuifolia  | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lamiaceae | Rabdosia rubescens  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Myrtaceae | Eucalyptus staigeriana | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Pandanaceae | Pandanus tectorius  | Ref. |
| Plantae | Pinaceae | Abies alba  | Ref. |
| Plantae | Pinaceae | Pinus banksiana  | Ref. |
| Plantae | Pinaceae | Pinus bungeana  | Ref. |
| Plantae | Pinaceae | Pinus contorta var. latifolia  | Ref. |
| Plantae | Pinaceae | Pinus koraiensis  | Ref. |
| Plantae | Pinaceae | Pinus taeda | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus medica  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Evodia rutaecarpa  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansii  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis var.latifolia  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Baeckea frutescens  | Ref. |
| - | - | Pelargonicum graveolens | Ref. |
|
|
zoom in
| Organism | Commiphora mukul | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|