| Name |
beta-Elemene Cyclohexane |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
33880-83-0 |
| C_ID |
C00007453
, 
|
| InChIKey |
OPFTUNCRGUEPRZ-QRSVUVFUNA-N |
| InChICode |
InChI=1S/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,13-14H,1-2,4,8-10H2,3,5-6H3/t13-,14+,15-/m1/s1 |
| SMILES |
C=C[C@]1(C)CC[C@@H](C(=C)C)C[C@H]1C(=C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Exhaled breath) | Ref. |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Guatteriopsis blepharophylla | Ref. |
| Plantae | Annonaceae | Monodora myristica  | Ref. |
| Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
| Plantae | Annonaceae | Xylopia frutescens  | Ref. |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Annonaceae | Xylopia rubescens | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Cuminum cyminum L.  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Apiaceae | Peucedanum paniculatum L. | Ref. |
| Plantae | Aristolochiaceae | Aristolochia trilobata  | Ref. |
| Plantae | Asteraceae | Artemisia annua L.cultivar Jwarharti  | Ref. |
| Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
| Plantae | Asteraceae | Chamomilla rectita | Ref. |
| Plantae | Asteraceae | Chrysanthemum spp. | Ref. |
| Plantae | Asteraceae | Cyathocline purpurea | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Solidago canadensis | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Cistaceae | Cistus albidus | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
| Plantae | Dipterocarpaceae | Doona spp. | Ref. |
| Plantae | Gymnomitriaceae | Marsupella aquatica | Ref. |
| Plantae | Jubulaceae | Frullania aterrima var. lepida | Ref. |
| Plantae | Jubulaceae | Frullania congesta | Ref. |
| Plantae | Jubulaceae | Frullania falciloba | Ref. |
| Plantae | Jubulaceae | Frullania fragilifolia | Ref. |
| Plantae | Jubulaceae | Frullania fugax | Ref. |
| Plantae | Jubulaceae | Frullania incumbens | Ref. |
| Plantae | Jubulaceae | Frullania lobulata | Ref. |
| Plantae | Jubulaceae | Frullania media | Ref. |
| Plantae | Jubulaceae | Frullania monocera | Ref. |
| Plantae | Jubulaceae | Frullania ptychantha | Ref. |
| Plantae | Labiatae | Mentha spp.  | Ref. |
| Plantae | Labiatae | Ocimum americanum  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Ocimum gratissimum  | Ref. |
| Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
| Plantae | Labiatae | Ocimum tenuiflorum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Lepidoziaceae | Lepidozia fauriana | Ref. |
| Plantae | Lepidoziaceae | Lepidozia vitrea | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Pinaceae | Pinus halepensis  | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
| Plantae | Pinaceae | Pinus sylvestris  | Ref. |
| Plantae | Piperaceae | Piper arboreum  | Ref. |
| Plantae | Piperaceae | Piper fimbriulatum | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Piperaceae | Piper obliquum  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Primulaceae | Primula halleri | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus deliciosa | Ref. |
| Plantae | Rutaceae | Citrus hystrix  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradise x Poncirus trifoliata | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus reticulate x Citrus sinensis | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus sinki x Poncirus trifoliata | Ref. |
| Plantae | Rutaceae | Citrus unshiu Marc.  | Ref. |
| Plantae | Rutaceae | Fortunella margarita  | Ref. |
| Plantae | Rutaceae | Murraya exotica  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Poncirus trifoliata  | Ref. |
| Plantae | Rutaceae | Poncirus trifoliate x Citrus sinensis | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Scapaniaceae | Tritomaria quinquedentata (Huds.) | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Curcuma aeruginosa  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Curcuma aromatica  | Ref. |
| Plantae | Zingiberaceae | Curcuma kwangsiensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
| Plantae | Zingiberaceae | Curcuma wenyujin  | Ref. |
| Plantae | Zingiberaceae | Zingiber cassumunar Roxb.  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Alphinia galanga | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Libanotis intermedia | Ref. |
|
|
zoom in
| Organism | Chamomilla rectita | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|