| Name |
24-Methylene cholesterol 24-Methylcholesta-5,24(28)-dien-3beta-ol 24-Methylenecholesterol |
| Formula |
C28H46O |
| Mw |
398.35486609 |
| CAS RN |
474-63-5 |
| C_ID |
C00007271
, 
|
| InChIKey |
INDVLXYUCBVVKW-QULHGUPUNA-N |
| InChICode |
InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9,18,20,22-26,29H,3,7-8,10-17H2,1-2,4-6H3/t20-,22+,23+,24-,25+,26-,27+,28-/m1/s1 |
| SMILES |
C=C(CC[C@@H](C)C1CCC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Drepanidae | Achlya bisexualis | Ref. |
| Chromalveolata | Pelagophyceae | Aureoumbra lagunensis | Ref. |
| Chromalveolata | Saprolegniaceae | Saprolegnia ferax | Ref. |
| Chromalveolata | Saprolegniaceae | Saprolegnia megasperma | Ref. |
| Chromista | Pelagomonadaceae | Aureococcus anophagefferens | Ref. |
| Fungi | Glomeraceae | Glomus sp. | Ref. |
| Fungi | Rhizophydiaceae | Rhizophydium sphaerotheca | Ref. |
| Plantae | Boraginaceae | Heliotropium indicum  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Laminariaceae | Laminaria japonica  | Ref. |
| Plantae | Malvaceae | Sida rhombifolia  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Solanaceae | Nicotiana benthamiana  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Leptolegnia caudata | Ref. |
| - | - | Nephthea chabroli | Ref. |
| - | - | Pythiopsis cymosa | Ref. |
| - | - | Sinularia dura | Ref. |
| - | - | Sinularia gibberosa | Ref. |
| - | - | Sinularia maxima | Ref. |
|
|
zoom in
| Organism | Leptolegnia caudata | | Reference | Lenfant,Phytochem.,9,(1970),2529-2535
Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Poppleston,Phytochem.,12,(1973),1131-1133
Turner,Fungal Metabolites II
Academic Press,New York, |
|---|
|