| Name |
Kaempferol 3-O-sophoroside Sophoraflavonoloside Kaempferol 3-O-beta-sophoroside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
19895-95-5 |
| C_ID |
C00005165
, 
|
| InChIKey |
LKZDFKLGDGSGEO-DMXBVYPFNA-N |
| InChICode |
InChI=1S/C27H30O16/c28-7-14-17(33)20(36)22(38)26(40-14)43-25-21(37)18(34)15(8-29)41-27(25)42-24-19(35)16-12(32)5-11(31)6-13(16)39-23(24)9-1-3-10(30)4-2-9/h1-6,14-15,17-18,20-22,25-34,36-38H,7-8H2/t14-,15-,17-,18-,20+,21+,22-,25-,26+,27+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O[C@@H]2OC(CO)[C@@H](O)C(O)[C@H]2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium tuberosum  | Ref. |
| Plantae | Apocynaceae | Thevetia neriifolia | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Chenopodiaceae | Chenopodium fremontii | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cyatheaceae | Cyathea spp. | Ref. |
| Plantae | Elaeagnaceae | Elaeagnus multiflora | Ref. |
| Plantae | Equisetaceae | Equisetum arvense  | Ref. |
| Plantae | Equisetaceae | Equisetum debile | Ref. |
| Plantae | Equisetaceae | Equisetum ramosissimum  | Ref. |
| Plantae | Fabaceae | Desmanthus illinoensis | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Styphnolobium japonicum (L.) Schott | Ref. |
| Plantae | Hostaceae | Hosta ventricosa | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Iridaceae | Crocus spp. | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Papaveraceae | Papaver nudicaule | Ref. |
| Plantae | Rosaceae | Eriobotrya japonica  | Ref. |
| Plantae | Solanaceae | Nicotiana spp. | Ref. |
| Plantae | Solanaceae | Solanum spp. | Ref. |
|
|
zoom in
| Organism | Moringa oleifera | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|