| Name |
Vanillic acid 3-Methoxy-4-hydroxybenzoic acid |
| Formula |
C8H8O4 |
| Mw |
168.04225874 |
| CAS RN |
121-34-6 |
| C_ID |
C00002682
, 
|
| InChIKey |
WKOLLVMJNQIZCI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H8O4/c1-12-7-4-5(8(10)11)2-3-6(7)9/h2-4,9H,1H3,(H,10,11) |
| SMILES |
COc1cc(C(=O)O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Pseudomonadaceae | Pseudomonas pseudoalcaligenes | Ref. |
| Bacteria | Streptomycetaceae | Streptomyces sp. GW23/1540 | Ref. |
| Plantae | Acanthaceae | Dicliptera riparia | Ref. |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Alliaceae | Allium Sativum | Ref. |
| Plantae | Amaranthaceae | Gomphrena celosioides | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Falcaria vulgaris | Ref. |
| Plantae | Apiaceae | Glehnia littoralis  | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Trachelospermum asiaticum  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia heterophylla  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia manshuriensis | Ref. |
| Plantae | Aristolochiaceae | Aristolochia pubescens | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Chamomilla rectita | Ref. |
| Plantae | Asteraceae | Cichorium intybus  | Ref. |
| Plantae | Asteraceae | Grindelia aphanactis | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Betulaceae | Alnus japonica  | Ref. |
| Plantae | Bignoniaceae | Paratecoma koraiensis | Ref. |
| Plantae | Cactaceae | Opuntia dillenii  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Celastraceae | Microtropis fokienensis | Ref. |
| Plantae | Celastraceae | Microtropis japonica | Ref. |
| Plantae | Combretaceae | Terminalia catappa  | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Combretaceae | Terminalia nigrovenulosa | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Convallariaceae | Tupistra chinensis | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes kirilowii  | Ref. |
| Plantae | Cymodoceaceae | Amphibolis antarctica | Ref. |
| Plantae | Cymodoceaceae | Amphibolis griffithii | Ref. |
| Plantae | Cymodoceaceae | Cymodocea rotundata | Ref. |
| Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
| Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
| Plantae | Cymodoceaceae | Halodule wrightii | Ref. |
| Plantae | Cymodoceaceae | Syringodium filiforme | Ref. |
| Plantae | Cymodoceaceae | Syringodium isoetifolium | Ref. |
| Plantae | Cymodoceaceae | Thalassodendron ciliatum | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Dipsacus asper | Ref. |
| Plantae | Elaeagnaceae | Elaeagnus pungens | Ref. |
| Plantae | Ephedraceae | Ephedra equisetina  | Ref. |
| Plantae | Ericaceae | Erica australis | Ref. |
| Plantae | Eriocaulaceae | Eriocaulon buergerianum | Ref. |
| Plantae | Euphorbiaceae | Cleidion spiciflorum (Burm. f.) Merr.  | Ref. |
| Plantae | Fabaceae | Amburana cearensis | Ref. |
| Plantae | Fabaceae | Derris scandens  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Pterocarpus santalinus  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Hydrocharitaceae | Halophila engelmannii | Ref. |
| Plantae | Hydrocharitaceae | Halophila hawaiiana | Ref. |
| Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
| Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Juglandaceae | Engelhardia roxburghiana | Ref. |
| Plantae | Labiatae | Ajuga taiwanensis | Ref. |
| Plantae | Labiatae | Callicarpa integerrima | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Lauraceae | Cinnamomum philippinense | Ref. |
| Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Malvaceae | Gossypium mexicanum | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Meliaceae | Melia azedarach  | Ref. |
| Plantae | Meliaceae | Toona ciliata  | Ref. |
| Plantae | Moraceae | Ficus septica | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Orchidaceae | Gymnadenia conopsea R.BR. | Ref. |
| Plantae | Oxalidaceae | Oxalis corniculata  | Ref. |
| Plantae | Paeoniaceae | Paeonia hybrida | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Pinaceae | Picea ajanensis | Ref. |
| Plantae | Pinaceae | Picea obovata | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Pinaceae | Pseudolarix kaempferi Gord.  | Ref. |
| Plantae | Piperaceae | Peperomia duclouxii C. DC. | Ref. |
| Plantae | Piperaceae | Peperomia sui | Ref. |
| Plantae | Plantaginaceae | Picrorhiza kurrooa | Ref. |
| Plantae | Plantaginaceae | Picrorhiza kurrosa | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago media  | Ref. |
| Plantae | Plantaginaceae | Veronica peregrina L.  | Ref. |
| Plantae | Plumbaginaceae | Ceratostigma willmottianum | Ref. |
| Plantae | Poaceae | Oryza sativa cv. Heugjinjubyeo  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays L.  | Ref. |
| Plantae | Polytrichaceae | Polytrichum commune | Ref. |
| Plantae | Posidoniaceae | Posidonia australis | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Ranunculaceae | Ranunculus baudotii | Ref. |
| Plantae | Rhamnaceae | Colubrina faralaotra subsp.trichocarpa. | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Rosa canina  | Ref. |
| Plantae | Rosaceae | Spiraea formosana  | Ref. |
| Plantae | Rubiaceae | Rubia yunnanensis | Ref. |
| Plantae | Rutaceae | Citrus sudachi  | Ref. |
| Plantae | Rutaceae | Fagara spp. | Ref. |
| Plantae | Rutaceae | Fagara tessmannii Engl. | Ref. |
| Plantae | Rutaceae | Phellodendron amurense var.wilsonii  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Rutaceae | Zanthoxylum simulans | Ref. |
| Plantae | Salicaceae | Populus pseudosimonii | Ref. |
| Plantae | Samydaceae | Casearia membranacea | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Sapindaceae | Acer nikoense  | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena diospyroidea | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena pauciflora | Ref. |
| Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
| Plantae | Simaroubaceae | Ailanthus integrifolia | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Trochodendraceae/Tetracentraceae | Tetracentron sinense  | Ref. |
| Plantae | Typhaceae/Sparganiaceae | Sparganium stoloniferum | Ref. |
| Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| Plantae | Zosteraceae | Phyllospadix scouleri | Ref. |
| Plantae | Zosteraceae | Phyllospadix serrulatus | Ref. |
| Plantae | Zosteraceae | Zostera marina | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | Aganosma caryophyllata | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Equsetum arvense | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Lentinula edodes  | Ref. |
| - | - | Opunitia dillenii HAW. | Ref. |
| - | - | Picrorrhiza scrophulariaeflora | Ref. |
| - | - | Picrorrhiza scrophulariiflora | Ref. |
| - | - | Sarcolaeana multiflora | Ref. |
| - | - | Scrophularis sambucifolia | Ref. |
|
|
zoom in
| Organism | Picrorrhiza scrophulariaeflora | | Reference | Xiao, et al., CCMM, 19, (1994), 421.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Wu, et al., Chem Pharm Bull, 53, (2005), 56.
YUAN, et al., Chem Pharm Bull, 50, (2002), 73.
QIU, et al., Chem Pharm Bull, 50, (2002), 1507.
MORIKAWA, et al., Chem Pharm Bull, 51, (2003), 62.
TAO, et al., Chem Pharm Bull, 51, (2003), 654.
CHAN, et al., Chem Pharm Bull, 53, (2005), 836.
LEU, et al., Chem Pharm Bull, 53, (2005), 853.
CHIU, et al., Chem Pharm Bull, 53, (2005), 1118.
Ma, et al., JNP, 65, (2002), 206.
Pan, et al., JNP, 66, (2003), 161.
Morikawa, et al., JNP, 66, (2003), 638.
Wu, et al., JNP, 66, (2003), 996.
Wu, et al., JNP, 66, (2003), 1207.
Chang, et al., Planta Med, 69, (2003), 667.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|