| Name |
Canadine (S)-(-)-Canadine (S)-Canadine |
| Formula |
C20H21NO4 |
| Mw |
339.14705817 |
| CAS RN |
5096-57-1 |
| C_ID |
C00028005
, 
|
| InChIKey |
VZTUIEROBZXUFA-XISACWJONA-N |
| InChICode |
InChI=1S/C20H21NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,8-9,16H,5-7,10-11H2,1-2H3/t16-/m0/s1 |
| SMILES |
COc1ccc2c(c1OC)CN1CCc3cc4c(cc3[C@@H]1C2)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fumariaceae | Corydalis cava  | Ref. |
| Plantae | Fumariaceae | Corydalis cheilanthifolia | Ref. |
| Plantae | Fumariaceae | Corydalis intermedia | Ref. |
| Plantae | Fumariaceae | Corydalis rotundatour | Ref. |
| Plantae | Fumariaceae | Corydalis solida  | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Fumariaceae | Hypecoum lactiflorum | Ref. |
| Plantae | Menispermaceae | Coscinium fenestratum  | Ref. |
| Plantae | Papaveraceae | Chelidonium majus  | Ref. |
| Plantae | Papaveraceae | Eschscholzia californica  | Ref. |
| Plantae | Papaveraceae | Macleaya cordata  | Ref. |
| Plantae | Papaveraceae | Papaver bracteatum  | Ref. |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Ranunculaceae | Thalictrum flavum | Ref. |
| Plantae | Ranunculaceae/Hydrastidaceae | Hydrastis canadensis  | Ref. |
| Plantae | Rutaceae | Zanthoxylum brachyacanthum | Ref. |
| Plantae | Rutaceae | Zanthoxylum veneficium | Ref. |
|
|
zoom in
| Organism | Zanthoxylum veneficium | | Reference | Hwang, et al., Planta Med, 69, (2003), 623.
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|