| Name |
Lignoceric acid Tetracosanoic acid |
| Formula |
C24H48O2 |
| Mw |
368.36543078 |
| CAS RN |
557-59-5 |
| C_ID |
C00001223
, 
|
| InChIKey |
QZZGJDVWLFXDLK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C24H48O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26/h2-23H2,1H3,(H,25,26) |
| SMILES |
CCCCCCCCCCCCCCCCCCCCCCCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Anthericaceae | Chlorophytum arundinaceum  | Ref. |
| Plantae | Apiaceae | Angelica sinensis  | Ref. |
| Plantae | Apiaceae | Bupleurum chinense | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Apiaceae | Peucedanum govanianum var.bicolo | Ref. |
| Plantae | Apiaceae | Saposhnikovia divaricata | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes kirilowii  | Ref. |
| Plantae | Fabaceae | Adenanthera pavonina  | Ref. |
| Plantae | Fabaceae | Clitoria ternata | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Anisomeles indica  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Longaniaceae | Strychnos nitida | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Pinaceae | Pinus koraiensis  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Zingiberaceae | Alpinia oxyphylla  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Strychnos nitida | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Rao, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 20, (1995), 740.
Gu, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 22, (1997), 40.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Morikawa, et al., Journal of Natural Products, 65, (2002), 1468 |
|---|
|