| Name |
Vitamin B3 Nicotinic acid Niacin |
| Formula |
C6H5NO2 |
| Mw |
123.03202841 |
| CAS RN |
59-67-6 |
| C_ID |
C00000208
, 
|
| InChIKey |
PVNIIMVLHYAWGP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9) |
| SMILES |
O=C(O)c1cccnc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| -- | Bangiaceae | Porphyra tenera  | Ref. |
| Animalia | Bombycidae | Bombyx mori  | Ref. |
| Animalia | Bovidae | Bos taurus domesticus  | Ref. |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Fungi | Mortierellaceae | Mortierella vinacea | Ref. |
| Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Anemarrhenaceae | Anemarrhena asphodeloides  | Ref. |
| Plantae | Apiaceae | Angelica sinensis  | Ref. |
| Plantae | Araceae | Colocasia escultenta | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea L. ssp. Botrytis  | Ref. |
| Plantae | Cucurbitaceae | Benincasa hispida  | Ref. |
| Plantae | Cyprinidae | Cyprinus carpio  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Tamarindus indica  | Ref. |
| Plantae | Labiatae | Ajuga taiwanensis | Ref. |
| Plantae | Lauraceae | Cassytha filiformis  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Solanaceae | Lycium chinense  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| - | - | Carpa hircus | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Gallus gallus domesticus  | Ref. |
|
|
zoom in
| Organism | Benincasa hispida | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
CHAN, et al., Chem Pharm Bull, 53, (2005), 836 |
|---|
|