| Name |
Kaempferol 3-O-sophoroside Sophoraflavonoloside Kaempferol 3-O-beta-sophoroside |
| Formula |
C27H30O16 |
| Mw |
610.15338491 |
| CAS RN |
19895-95-5 |
| C_ID |
C00005165
, 
|
| InChIKey |
LKZDFKLGDGSGEO-DMXBVYPFNA-N |
| InChICode |
InChI=1S/C27H30O16/c28-7-14-17(33)20(36)22(38)26(40-14)43-25-21(37)18(34)15(8-29)41-27(25)42-24-19(35)16-12(32)5-11(31)6-13(16)39-23(24)9-1-3-10(30)4-2-9/h1-6,14-15,17-18,20-22,25-34,36-38H,7-8H2/t14-,15-,17-,18-,20+,21+,22-,25-,26+,27+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O[C@@H]2OC(CO)[C@@H](O)C(O)[C@H]2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium tuberosum  | Ref. |
| Plantae | Apocynaceae | Thevetia neriifolia | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Chenopodiaceae | Chenopodium fremontii | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cyatheaceae | Cyathea spp. | Ref. |
| Plantae | Elaeagnaceae | Elaeagnus multiflora | Ref. |
| Plantae | Equisetaceae | Equisetum arvense  | Ref. |
| Plantae | Equisetaceae | Equisetum debile | Ref. |
| Plantae | Equisetaceae | Equisetum ramosissimum  | Ref. |
| Plantae | Fabaceae | Desmanthus illinoensis | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Styphnolobium japonicum (L.) Schott | Ref. |
| Plantae | Hostaceae | Hosta ventricosa | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Iridaceae | Crocus spp. | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Papaveraceae | Papaver nudicaule | Ref. |
| Plantae | Rosaceae | Eriobotrya japonica  | Ref. |
| Plantae | Solanaceae | Nicotiana spp. | Ref. |
| Plantae | Solanaceae | Solanum spp. | Ref. |
|
|
zoom in
| Organism | Crocus sativus | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
TEWTRAKUL, et al., Chem Pharm Bull, 50, (2002), 630 |
|---|
|