| Name |
Chrysosplenetin 5,4'-Dihydroxy-3,6,7,3'-tetramethoxyflavone Quercetagetin 3,6,7,3'-tetramethyl ether Polycladin 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
603-56-5 |
| C_ID |
C00004704
, 
|
| InChIKey |
NBVTYGIYKCPHQN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-11-7-9(5-6-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3 |
| SMILES |
COc1cc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2OC)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea ageratum  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia mongolica | Ref. |
| Plantae | Asteraceae | Artemisia sieversiana  | Ref. |
| Plantae | Asteraceae | Blumea malcomii | Ref. |
| Plantae | Asteraceae | Grindelia robusta | Ref. |
| Plantae | Asteraceae | Grindelia tarapacana | Ref. |
| Plantae | Asteraceae | Haplopappus bezanillanus | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Parthenium incanum | Ref. |
| Plantae | Asteraceae | Parthenium rollinsianum | Ref. |
| Plantae | Asteraceae | Pulicaria gnaphaloides  | Ref. |
| Plantae | Betulaceae | Alnus koehnei | Ref. |
| Plantae | Capparaceae | Cleome spp. | Ref. |
| Plantae | Labiatae | Plectranthus marrubioides | Ref. |
| Plantae | Labiatae | Stachys aegyptiaca | Ref. |
| Plantae | Lamiaceae | Coleus aromaticus  | Ref. |
| Plantae | Plantaginaceae | Adenosma capitatum | Ref. |
| Plantae | Plantaginaceae | Digitalis thapsi  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Saxifragaceae | Chrysosplenium japonicum | Ref. |
| Plantae | Saxifragaceae | Chrysosplenium tosaense | Ref. |
|
|
zoom in
| Organism | Plectranthus marrubioides | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Hansel,Naturwissenschaften,53,(1966),19 |
|---|
|