| Name |
Eugenol |
| Formula |
C10H12O2 |
| Mw |
164.08372963 |
| CAS RN |
97-53-0 |
| C_ID |
C00000619
, 
|
| InChIKey |
RRAFCDWBNXTKKO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3,5-7,11H,1,4H2,2H3 |
| SMILES |
C=CCc1ccc(O)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Acoraceae | Acorus tatarinowii  | Ref. |
| Plantae | Amaryllidaceae | Narcissus tazetta var.chinensis  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Aneuraceae | Riccardia multifida subsp. Decrescens | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Bupleurum chinense | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Aristolochiaceae | Asarum forbesii | Ref. |
| Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
| Plantae | Asteraceae | Achillea fragrantissima  | Ref. |
| Plantae | Asteraceae | Achillea millefolium  | Ref. |
| Plantae | Asteraceae | Achillea moschata | Ref. |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia capillaris  | Ref. |
| Plantae | Asteraceae | Artemisia klotzschiana | Ref. |
| Plantae | Asteraceae | Artemisia scoparia  | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Burseraceae | Commiphora mukul  | Ref. |
| Plantae | Burseraceae | Commiphora myrrha  | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Cannabaceae | Cannabis sativa  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Caryophyllaceae | Dianthus chinensis  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Cruciferae | Brassica hirta  | Ref. |
| Plantae | Cruciferae | Hesperis matronalis  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Mosla chinensis | Ref. |
| Plantae | Labiatae | Nepeta cataria  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Ocimum sanctum  | Ref. |
| Plantae | Labiatae | Ocimum spp. | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Perilla frutescens var.acuta  | Ref. |
| Plantae | Labiatae | Plectranthus marrubioides | Ref. |
| Plantae | Labiatae | Pogostemon cablin  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta subsp. glandulosa  | Ref. |
| Plantae | Lamiaceae | Coleus aromaticus  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
| Plantae | Lauraceae | Cinnamomum japonicum | Ref. |
| Plantae | Lauraceae | Cinnamomum parthenoxylum | Ref. |
| Plantae | Lauraceae | Cinnamomum spp. | Ref. |
| Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
| Plantae | Lauraceae | Cinnamomum tamala  | Ref. |
| Plantae | Lauraceae | Cinnamomum zeylanicum  | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Lauraceae | Sassafras randaiense | Ref. |
| Plantae | Lauraceae | Sassafras randainense | Ref. |
| Plantae | Lauraceae | Sassafras tzumu | Ref. |
| Plantae | Magnoliaceae | Magnolia liliflora  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Malvaceae | Hibiscus sabdariffa L.  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Myristicaceae | Myristica fragrans  | Ref. |
| Plantae | Myrtaceae | Eugenia caryophyllata  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Myrtaceae | Pimenta dioica  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Orobanchaceae | Siphonostegia chinensis | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Piperaceae | Peperomia sui | Ref. |
| Plantae | Piperaceae | Piper betle  | Ref. |
| Plantae | Piperaceae | Piper taiwanense | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Ranunculaceae | Delphinium yunnanense | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Rosa rugosa  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Toddalia asiatica  | Ref. |
| Plantae | Salicaceae | Salix aegyptiaca | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia amplexicaulis | Ref. |
| Plantae | Scrophulariaceae | Scrophularia oxysepala | Ref. |
| Plantae | Solanaceae | Cestrum nocturnum  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Nicotiana bonariensis | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Taxaceae | Taxus wallichiana  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Verbenaceae | Lippia javanica  | Ref. |
| Plantae | Zingiberaceae | Alpinia galanga  | Ref. |
| Plantae | Zingiberaceae | Alpinia officinarum  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Alphinia galanga | Ref. |
| - | - | Baeckea frutescens L.  | Ref. |
| - | - | Jackiella javanica | Ref. |
| - | - | Ulva pertusa | Ref. |
|
|
zoom in
| Organism | Achillea moschata | | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Chen, et al., Planta Med, 70, (2004), 174.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Xie, et al., Chapter 28, JIU LI XIANG, in Modern Stydies of Chinese Herbal Medicine, edited. By Institute of Materia Medica, Chinese Academy of Medical Sciences, Vol.2, 333-61, Union Press of Beijing Medical University and Peking Union Medical College, Geijing, (1996).
Huang, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 22, (1997), 247. |
|---|
|