| Name |
Izalpinin 7-O-Methylgalangin Galangin 7-methyl ether 3,5-Dihydroxy-7-methoxy-2-phenyl-4H-1-benzopyran-4-one 3,5-Dihydroxy-7-methoxyflavone |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
480-14-8 |
| C_ID |
C00004536
, 
|
| InChIKey |
PVJNLMXWZXXHSZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-10-7-11(17)13-12(8-10)21-16(15(19)14(13)18)9-5-3-2-4-6-9/h2-8,17,19H,1H3 |
| SMILES |
COc1cc(O)c2c(=O)c(O)c(-c3ccccc3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Cyprinidae | Carassius auratus  | Ref. |
| Plantae | Asteraceae | Baccharis viminea | Ref. |
| Plantae | Asteraceae | Flourensia resinosa | Ref. |
| Plantae | Asteraceae | Helichrysum aureum | Ref. |
| Plantae | Asteraceae | Olearia nummularifolia | Ref. |
| Plantae | Asteraceae | Ozothamnus ledifolius | Ref. |
| Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
| Plantae | Capparaceae | Capparis tweediana  | Ref. |
| Plantae | Iridaceae | Iris tenuifolia | Ref. |
| Plantae | Myricaceae | Comptonia peregrina  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus antarctica | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
| Plantae | Pinaceae | Pinus morrisonicola | Ref. |
| Plantae | Pteridaceae | Platyzoma microphyllum | Ref. |
| Plantae | Zamiaceae | Apis mellifera ligustica  | Ref. |
| Plantae | Zingiberaceae | Alpinia chinensis | Ref. |
| Plantae | Zingiberaceae | Alpinia japonica | Ref. |
| Plantae | Zingiberaceae | Alpinia oxyphylla  | Ref. |
|
|
zoom in
| Organism | Apis mellifera ligustica | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chi, et al., Chinese Pharmaceutical Journal(Zhongguo Yaoxue Zazhi), 31, (1996), 264.
Morikawa, et al., Journal of Natural Products, 65, (2002), 1468 |
|---|
|