| Name |
Pratensein 5,7,3'-Trihydroxy-4'-methoxyisoflavone |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
2284-31-3 |
| C_ID |
C00002563
, 
|
| InChIKey |
FPIOBTBNRZPWJW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-13-3-2-8(4-11(13)18)10-7-22-14-6-9(17)5-12(19)15(14)16(10)20/h2-7,17-19H,1H3 |
| SMILES |
COc1ccc(-c2coc3cc(O)cc(O)c3c2=O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Inula britannica var.chinensis  | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Dalbergia parviflora  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Monopteryx inpae | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Sophora secundiflora  | Ref. |
| Plantae | Fabaceae | Thermopsis spp. | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Fabaceae | Trifolium subterraneum  | Ref. |
|
|
zoom in
| Organism | Trifolium repens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|