| Name |
Cinnamate trans-Cinnamic acid trans-Cinnamate |
| Formula |
C9H8O2 |
| Mw |
148.0524295 |
| CAS RN |
140-10-3 |
| C_ID |
C00000170
, 
|
| InChIKey |
WBYWAXJHAXSJNI-VOTSOKGWSA-N |
| InChICode |
InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
| SMILES |
O=C(O)/C=C/c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Marasmiaceae | Pleurocybella porrigens  | Ref. |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Araliaceae | Tetrapanax papyriferus | Ref. |
| Plantae | Asteraceae | Helianthus tuberosus  | Ref. |
| Plantae | Asteraceae | Parthenium argentatum | Ref. |
| Plantae | Cistaceae | Cistus ladaniferus  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica napus  | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. gongylodes  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum coca  | Ref. |
| Plantae | Fabaceae | Cassia spectabilis  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus aureus  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Globulariaceae | Globularia spp. | Ref. |
| Plantae | Hamamelidaceae | Liquidambar orientalis  | Ref. |
| Plantae | Labiatae | Melissa officinalis  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Lauraceae | Cinnamomum spp. | Ref. |
| Plantae | Liliaceae | Lilium candidum  | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Poaceae | Gynerium sagittatum  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Scrophulariaceae | Leucophyllum ambiguum | Ref. |
| Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia nodosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia striata  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia takesimensis | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Vitaceae | Vitis rupestris | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| Plantae | Zingiberaceae | Alpinia spp.  | Ref. |
| - | - | Paraburkholderia phymatum | Ref. |
|
|
zoom in
| Organism | Cassia spectabilis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|