| Name |
Matrine, N-oxide (+)-Matrine N-oxide Matrine N-oxide Oxymatrine Ammothamnine Matrine 1beta-oxide (+)-Oxymatrine |
| Formula |
C15H24N2O2 |
| Mw |
264.18377802 |
| CAS RN |
16837-52-8 |
| C_ID |
C00007758
, 
|
| InChIKey |
XVPBINOPNYFXID-YFSZZWNFNA-N |
| InChICode |
InChI=1S/C15H24N2O2/c18-14-7-1-6-13-12-5-3-9-17(19)8-2-4-11(15(12)17)10-16(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-,17+/m0/s1 |
| SMILES |
O=C1CCC[C@@H]2[C@H]3CCC[N@+]4([O-])CCC[C@@H](CN12)[C@@H]34 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Daphniphyllaceae | Daphniphyllum oldhami | Ref. |
| Plantae | Fabaceae | Ammothamnus lehmanni | Ref. |
| Plantae | Fabaceae | Ammothamnus songoricus | Ref. |
| Plantae | Fabaceae | Genista aucheri | Ref. |
| Plantae | Fabaceae | Sophora alopecuroides | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora flavescens var. angustifolia  | Ref. |
| Plantae | Fabaceae | Sophora moorcroftiana Benth.  | Ref. |
| Plantae | Fabaceae | Sophora pachycarpa Schrenk. | Ref. |
| Plantae | Fabaceae | Sophora subprostate | Ref. |
| Plantae | Fabaceae | Sophora subprostrata | Ref. |
| Plantae | Fabaceae | Sophora tonkinensis | Ref. |
| Plantae | Fabaceae | Sophora viciifolia | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| - | - | Sophorae flavescentis | Ref. |
|
|
zoom in
| Organism | Corydalis yanhusuo | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|